Stay Informed

By signing up you will periodically receive updates of potentially life changing information. Both for yourself and your family. You can unsubscribe at any time.


Pesticides and Plant Growth Regulators used and approved in - Australia

APVMA (Australian Pesticides and Veterinary Medicines Authority) determines which pesticides are allowed to be used in Australia. This list is based on Record of approved active constituents. Note that Pesticide Inerts - i.e. extra and mostly undeclared ingredients - are not included here. See the article - "Major Pesticides Are More Toxic to Human Cells Than Their Declared Active Principles"

The APVMA is the Australian government statutory authority responsible for the assessment and registration of pesticides and veterinary medicines, and for their regulation up to and including the point of retail sale. It sits within the portfolio of the Minister for Agriculture.

The APVMA monitors the market to provide assurance that only those products that meet the APVMA's requirements are being supplied. The APVMA also reviews registered chemical products to ensure that they continue to meet contemporary high standards. The states and territories are responsible for regulating and managing the use of pesticides and veterinary medicines once they are sold.

List sorted alphabetically. Synonyms and Brand names (small grey text) included as they become available. Use your keyboard/browser search function to find what you want or just browse the alphabetical list.

See our References and Toxin Profiles for additional details.



KEY: Nasty Attributes 7

Exposure Routes 1

Description Available i

Health Information Available +


abamectin95
avermectin
Acephate+i94
Acephic acid | Acetamidophos | Acetylphosphoramidothioic acid O,S-dimethyl ester | N-(Methoxy(methylthio)phosphinoyl)acetamide | O,S-Dimethyl acetylamidothiophosphate | O,S-Dimethylacetylphosphoroamidothioate
Acetamipridi72
(e)-N-((6-chloro-3-Pyridinyl)methyl)-n'-cyano-N-methylethanimidamide | (e)-N-(6-chloro-3-Pyridyl)methyl-n'-cyano-N-methylacetamidine
Acibenzolar-S-Methyli62
1,2,3-Benzothiadiazole-7-carboxlic acid thiomethyl ester | 7-(Methylthiocarbonyl)-benzo-1,2,3-thiadiazole | Acibenzolar-S-methyl | Actigard | Benzo-(1,2,3)-thiadiazole-7-carbothioic acid S-methyl ester | BTH | S-Methyl benzo[1,2,3]thiadiazole-7-carbothioate
Acifluorfeni22
(sodium salt) scifluorfen | 2-Nitro-5-(2-chloro-4-(trifluoromethyl)phenoxy)benzoic acid | 5-(2-Chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoate | 5-(2-Chloro-4-(trifluoromethyl)phenoxy)-2-nitrobenzoic acid | 5-(2-Chloro-4-trifluoromethylphenoxy)-2-nitrobenzoic acid | 5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid | 5-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-nitrobenzoic acid | 9CI | Acifluorfene | ACJ | Blazer | C14H7ClF3NO5 | Carbofluorfen | Scifluorfen | Tackle | Tackle 25
ACRIFLAVINE3
Acrolein+i811
2-Propen-1-one | 2-Propenal | 2-Propenaldehyde | Acquinite | Acraldehyde | Acrylaldehyde | Acrylic Aldehyde | Aldehyde | acrylic | Allyl aldehyde | Aqualin | Aqualine | Biocide | CH2=CHCHO | Crolean | Ethylene aldehyde | Magnacide | Magnacide H | Papite | Prop-2-En-1-al | Prop-2-enal | Propenal | Propenaldehyde | Propylene aldehyde | Slimicide | trans-Acrolein Formylethylene
Albendazole+i64
(5-(Propylthio)-1H-benzimidazol-2-yl)carbamic acid methyl ester | 5-(Propylthio)-2-carbomethoxyaminobenzimidazole | Abentel | ABZ | Acure | Adazol | AL | Albendazol | Albendazolum | Albenza | Band | Bandy | Bazole | Ben-A | Benrod | Bentil | Benzol | Benzole | Bevindazol | Biwom | Bruzol | Buxol | Cental | Champs | Ciclopar | Cidazole | Clearworm | Dalben | Despar | Eskazole | O-Methyl N-(5-(propylthio)-2-benzimidazolyl)carbamate | Proftril | Ricobendazole | Rycobendazole | Valbazen | Zentel | Zolben
Aldoxycarb+i32
2-Mesyl-2-methylpropionaldehyde O-methylcarbamoyloxime | Aldicarb-sulfone | Caswell No. 011AA | RCRA waste no. P203 | Standak | Sulfocarb | Temik sulfone
Allantoini22
(S)-allantoin | 2,5-Dioxo-4-imidazolidinyl-urea | 4-Ureido-2,5-Imidazolidinedione | 5-Ureido-Hydantoin | 5-Ureidohydantoin | 5-Ureidohydrantoin | Alantan | Allantol | Alloxantin | AVC/Dienestrolcream | Cordianine | D00121 | Fancol TOIN | Glyoxyldiureid | Glyoxyldiureide | Glyoxylic diureide | N-(2,5-Dioxo-4-imidazolidinyl)urea | Psoralon | Sebical | Septalan
Allethrin+i84
(+ )-Trans-bioallethrin | (+)-Allelrethonyl (+)-cis,trans-chrysanthemate | (+)-Allethronyl (+)-trans-chrysanthemumate | (+)-Trans-bioallethrin | (+)-trans-Chrysanthemumic acid ester OF (+-)-allethrolone | (+)-trans-Chrysanthemumic acid ester OF (.+-.)-allethrolone | (+-)-Allerethonyl (+-)-cis,trans-chrysanthemate | (.+-.)-Allelrethonyl (.+-.)-cis,trans-chrysanthemate | (.+/-.)-allelrethonyl (.+/-.)-cis,trans-chrysanthemate | 2,2-Dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylic acid 2-methyl-4-oxo-3-(2-propenyl)-2-cyclopenten-1-yl ester | 3-Allyl-2-methyl-4-oxo-2-cyclopenten-1-yl chrysanthemate | 3-Allyl-2-methyl-4-oxocyclopent-2-en-1-yl 2,2-dimethyl-3-(2-methylprop-1-en-1-yl)cyclopropanecarboxylate | 3-Allyl-4-keto-2-methylcyclopentenyl chrysanthemum monocarboxylate | Allethrin coil | Allethrin I | ALLETHRIN-1 | ALLETHRIN-2 | Allethrine | Allethrolone ester OF chrysanthemummonocarboxylic acid | Alleviate | Allyl cinerin I | Allyl homolog of cinerin I | Allylrethronyl DL-cis-trans-chrysanthemate | Alpha-DL-trans-allethrin | Binamin forte | Bioaletrina | Bioaletrina (portuguese) | Bioallethrin | Caswell No. 025 | Cinerin I allyl homolog | Cis-allethrin | D-allethrin | D-allethrolone chrysanthemumate | D-allethrolone d-trans-chrysanthemumate | D-cis,trans-allethrin | D-t-allethrin | D-trans allethrin | Depallethrin | Duocide | Esbioallethrin | Esbiol | Esbiol concentrate | Esbiol TM Intermediate 3336 | Esbiothrin | Esdepallethrine | Exthrin | Matox | MGK allethrin concentrate | Necarboxylic acid | Pallethrine | Pynamin | Pynamin-forte | Pyresin | Pyresyn | Pyrethrin | Pyrexcel | Pyrocide | S-bioallethrin | Trans-(+)-allethrin | Trans-allethrin | Wasp killer II | Wasp stopper CF
alpha-cypermethrin75
alphamethrin
Aluminium phosphide+i64
Aluminum phosphide | Aluminum phosphide (alp) | Caswell No. 031 | Celphide | Celphine | Celphos | Fumitoxin | Gastion | Phostoxin | Phostoxin-a | RCRA waste number P006 | Talunex
ametoctradin5
Ametryni41
2-(methylthio)-4-(Ethylamino)-6-(isopropylamino)-S-triazine | 2-Ethylamino-4-isopropylamino-6-methylmercapto-S-triazine | 2-methylthio-4-Ethylamino-6-isopropylamino-S-triazine | Ametrex | Ametryne | Evik | Gesapax | N-Ethyl-n'-(1-methylethyl)-6-(methylthio)-1,3,5-triazine-2,4-diamine | N-Ethyl-n'-(1-methylethyl)-6-(methylthio)-2,4-diaminetriazine | N-Ethyl-n'-isopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine
amicarbazone3
aminopyralid4
Amitraz+i65
Mitac
Amitrole (NB: Overall evaluation downgraded to Group 3 with supp orting evidence from other relevant data)55
aminotriazole
Aspirin+i55
2-(Acetyloxy)benzoate | 2-(Acetyloxy)benzoic acid | 2-Acetoxybenzenecarboxylic acid | 2-Acetoxybenzoate | 2-Acetoxybenzoic acid | 2-Carboxyphenyl acetate | Acenterine | Acetard | Aceticyl | Acetol | Acetonyl | Acetophen | Acetosal | Acetosalin | Acetylin | Acetylsalicylate | Acetylsalicylic acid | Acetylsalicylsaeure | Acetyonyl | Acetysal | Acetysalicylic acid | Acide 2-(acetyloxy)benzoique | Acide acétylsalicylique | ácido acetilsalicílico | Acidum acetylsalicylicum | Acylpyrin | Adiro | ASA | Asatard | Aspergum | Aspirdrops | Aspro | Azetylsalizylsaeure | Azetylsalizylsäure | Bayer Aspirin | Benaspir | Bialpirinia | Bufferin | Caprin | Cardioaspirina | Easprin | Ecolen | Ecotrin | Empirin | Endosprin | Endydol | Entrophen | Nu-seals | O-(Acetyloxy)benzoate | O-(Acetyloxy)benzoic acid | O-Acetoxybenzoate | O-Acetoxybenzoic acid | O-Acetylsalicylic acid | O-Carboxyphenyl acetate | Persistin | Pharmacin | Polopiryna | Premaspin | Rheumintabletten | Rhodine | Rhonal | Salcetogen | Saletin | Salicylic acid acetate | Salospir | Solprin | Solprin acid | Solpyron | St. Joseph Aspirin for Adults | Tasprin | Temperal | Toldex | Triaminicin
Asulam+i32
4-Amino-benzolsulfonyl-methylcarbamat | Asilan | Asulfox f | Asulox | Asulox 40 | Asulox f | Carbamic acid | ((4-aminophenyl)sulfonyl)- | methyl ester | Carbamic acid | 4-aminobenzenesulfonyl- | methyl ester | Carbamic acid | sulfanilyl- | methyl ester | Carbamic acid | [(4-aminophenyl)sulfonyl]- | methyl ester | Caswell No. 062A | Jonnix | Methyl ((4-aminophenyl)sulfonyl)carbamate | Methyl 4-aminophenylsulphonyl carbamate | Methyl 4-aminophenylsulphonylcarbamate | Methyl N-(4-aminobenzenesulfonyl)carbamate | Methyl N-(4-aminophenyl)sulfonylcarbamate | Methyl N-(4-aminophenylsulfonyl)carbamate | Methyl p-aminobenzenesulfonylcarbamate | Methyl sulfanilyl carbamate | Methyl sulfanilylcarbamate | Methyl sulphanilylcarbamate | Methyl [(4-aminophenyl)sulfonyl]carbamate | N-1-Methoxycarbonylsulfanilamide | N1-Methoxycarbonylsulfanilamide | Plakin | sodium [(4-aminophenyl)sulfonyl](methoxycarbonyl)azanide
Asulam, sodium salt+i32
Asulam sodium | Asulam-sodium | Asulox | Asulox | sodium salt | Carbamic acid | sulfanilyl- | methyl ester | monosodium salt | Caswell No. 062B | Methyl sulfanilylcarbamate | sodium salt | Sodium asulam | Sodium methyl ((4-aminophenyl)sulphonyl)carbamate
Atrazinei94
1-Chloro-3-(ethylamino)-5-(isopropylamino)-2,4,6-triazine | 1-Chloro-3-(ethylamino)-5-(isopropylamino)-S-triazine | 2-Aethylamino-4-chlor-6-isopropylamino-1,3,5-triazin | 2-Chloro-4-(2-propylamino)-6-(ethylamino)-S-triazine | 2-Chloro-4-(ethylamino)-6-(isopropylamino)-1,3,5-triazine | 2-Chloro-4-(ethylamino)-6-(isopropylamino)-S-Triazine | 2-Chloro-4-ethylamineisopropylamine-S-triazine | 2-Chloro-4-ethylamino-6-isopropylamino-1,3,5-triazine | 2-Chloro-4-ethylamino-6-isopropylamino-S-Triazine | 2-CHLORO-4-ISOPROPYLAMINO-6-ETHYLAMINO -1,3,5-TRIAZINE | 2-CHLORO-4-ISOPROPYLAMINO-6-ETHYLAMINO-1,3,5-TRIAZINE | 2-Ethylamino-4-isopropylamino-6-chloro-S-triazine | 6-Chloro-4-(ethylamino)-2-(isopropylamino)-S-triazine | 6-Chloro-N-ethyl-N'-(1-methylethyl)-1,3,5-triazine-2,4-diamine | 6-Chloro-N-ethyl-N'-(propan-2-yl)-1,3,5-triazine-2,4-diamine | 6-Chloro-N-ethyl-N'-isopropyl-1,3,5-triazine-2,4-diamine | Aatram | Aatrex | Aatrex 4L | Aatrex 4LC | Aatrex 80W | Aatrex nine-O | Actinite PK | Akticon | Aktikon | Aktikon PK | Aktinit A | Aktinit PK | Argezin | Atazinax | Atraflow | Atraflow plus | Atranex | Atrasine | Atrataf | Atratol | Atratol A | Atrazin | Atrazine 4L | Atrazine 80W | Atred | Atrex | Attrex | ATZ | Azinotox 500 | Candex | Cekuzina-T | Chromozin | Crisamina | Crisatrina | Crisazine | Cyazin | Farmco atrazine | Farmozine | Fenamin | Fenamine | Fenatrol | Fogard | Gesaprim | Gesaprim 50 | Gesoprim | Griffex | Griffex 4L | Herbatoxol | Hungazin | Hungazin PK | Inakor | Laddock | Maizina | Mebazine | Oleogesaprim | Pitezin | Primatol | Primatol A | Primaze | Primoleo | Radazin | Radazin T | Radizin | Radizine | Strazine | Triazine A 1294 | Vectal | Vectal SC | Weedex A | Wonuk | Zeaphos | Zeapos | Zeazin | Zeazine | Zeopos
azaconazole4
azadirachtin51
extract of neem oil
azafenidin45
Azamethiphos+i32
6-chloro-3-Dimethoxyphosphinoylthiomethyl-1,3-oxazolo(4,5-b)pyridin-2(3H)-one | S-((6-Chloro-2,3-dihydro-2-oxo-1,3-oxazolo-(4,5-b)pyridin-3-yl)methyl) O,O-dimethyl phosphorothioate | S-((6-chloro-2-Oxooxazolo(4,5-b)pyridin-3(2H)-yl)methyl) O,O-dimethylphosphorothioate | S-6-chloro-2,3-dihydro-2-oxo-1,3-Oxazolo(4,5-b)pyridin-3-ylmethyl O,O-dimethyl phosphorothioate | S-[(6-chloro-2-oxo[1,3]Oxazolo[4,5-b]pyridin-3(2H)-yl)methyl] O,O-dimethyl thiophosphate
azimsulfuron51
Azoxystrobini63
(AlphaE)-2-[[6-(2-cyanophenoxy)-4-pyrimidinyl]oxy]-alpha-(methoxymethylene) benzeneacetic acid methyl ester | Methyl (e)-2-[2-[6-(2-cyanophenoxy)pyrimidin-4-yloxy]phenyl]-3-methoxyacrylate
BACILLUS THURINGIENSIS STRAIN MPPL 0023
BALSAM PERU3
Beauveria bassiana3
benalaxyl51
benalaxyl-M
Bendiocarb+i55
1,3-Benzodioxol-4-ol | 2,2-dimethyl- | methylcarbamate | 2,2-Dimethyl-1,3-benzdioxol-4-yl N-methylcarbamate | 2,2-Dimethyl-1,3-benzodioxol-4-ol methylcarbamate | 2,2-Dimethyl-1,3-benzodioxol-4-yl methylcarbamate | 2,2-dimethyl-1,3-benzodioxole-N-methylcarbamate | 2,2-dimethyl-4-(methylcarbamoyloxy)-1,3-benzodioxole | 2,2-Dimethylbenzo-1,3-dioxol-4-yl methylcarbamate | 2,3-Isopropylidene-dioxyphenyl methylcarbamate | 2,3-Isopropylidenedioxyphenyl methylcarbamate | Bencarbate | Bendiocarbamate | Bendiocarbe | Dycarb | Ficam | Ficam 80 W | FICAM 80W | Ficam b | Ficam d | Ficam plus | Ficam ulv | Ficam ulv' ul | Ficam w | Ficam z | Fisons NC 6897 | FUAM | Garvox | Methylcarbamic acid 2,3-(isopropylidenedioxy)phenyl ester | Multamat | Multimet | Niomil | RCRA waste no. U278 | Rotate | Sedox | Seedox | Seedox 80W | Seedox SC | Seedoxin | Tatoo | Tattoo | Turcam
Bensulfuron-methyli52
Bensulfuron methyl | Methyl bensulfuron
Bensulide+i53
Benzulfide | Betamec | Betasan | Betasan E | Betasan G | Disan | Exporsan | Kayaphenone | N-(2-(O,O-Diisopropyldithiophosphoryl)ethyl)benzenesulfonamide | N-(2-Ethylthio)benzene sulphonamide-S,O,O-diisopropylphosphorodithioate | O,O-Di-isopropyl S-2-Phenylsulfonylaminoethyl Phosphorodithioate | O,O-Di-isopropyl S-2-phenylsulphonylaminoethyl phosphorodithioate | O,O-Diisopropyl phosphorothioate S-ester with N-(2-mercaptoethyl)benzenesulfonamide | O,O-Diisopropyl S-(2-[(phenylsulfonyl)amino]ethyl) dithiophosphate | O,O-Diisopropyl S-{2-[(phenylsulfonyl)amino]ethyl} phosphorodithioate
Bentazoni52
bendioxide, bentazon
benzofenap3
beta-cypermethrin51
Bifenazatei71
2-(4-Methoxy(1,1'-biphenyl)-3-yl)hydrazinecarboxylic acid 1-methylethyl ester | Bifenazic acid | Isopropyl 2-(4-methoxybiphenyl-3-yl)hydrazinecarboxylate
Bifenthrin+i113
Bifenthrine | Bifentrin | Biphenate | Biphenthrin | Biphentrin | Brigade | Capture | Talstar
Bioresmethrin+i43
(+)-trans-resmethrin | 1R-trans-Resemethrin | 5-Benzyl-3-furylmethyl (+)-trans-chrysanthemate | 5-Benzyl-3-furylmethyl (1R)-trans-chrysanthemate | Biobenzyfuroline | Resmethrin
bistrifluron3
bitertanol3
baycor
BITTER ORANGE EXTRACT3
Boscalidi5
2-Chloro-N-(4'-chloro-2-biphenylyl)nicotinamide | 2-Chloro-N-(4'-chlorobiphenyl-2-yl)pyridine-3-carboxamide | Endura | Nicobifen
Brodifacoum+i65
BFC | Brodifakum | Bromfenacoum | Klerat | Ratak | Super warfarin | Superwarfarin | Talon | Talon rodenticide | Talon-g | Volid
Bromacili4
5-bromo-3-(butan-2-yl)-6-methylpyrimidine-2,4(1H,3H)-dione | 5-Bromo-3-sec-butyl-6-methyl-2,4(1H,3H)-pyrimidinedione | 5-Bromo-3-sec-butyl-6-methylpyrimidine-2,4(1H,3H)-dione | 5-Bromo-3-sec.-butyl-6-methyluracil | Borea | Borocil | Bromax | Bromazil | Hyvar | Hyvar X | Hyvarex | Krova | Krovar II | Rokar X | Uragan | Uragon | Urox B | Urox-HX
Bromadiolone+i62
Boldo | Boot hill | Bromadiolon | Bromatrol | Bromodialone | Bromodiolone | Bromone | Bromore | Broprodifacoum | Canadien 2000 | Contrac | Contrax | Eradic | MAKI | Rafix | Ratimus | Rotox | Sup'operats | Super-caid | Super-cald | Super-rozol | Temus | Topidion
Bromomethane+i67
Bercema | BMM | Brom-methan | Brom-O-gas | Brom-O-gas methyl bromide soil fumigant | Brom-O-gaz | Brom-O-sol | Brommethan | Bromo-Methane | Bromometano | Bromur di metile | Bromure de methyle | Bromuro di metile | Broommethaan | Celfume | CH3Br | Chlorodibromomethane | Curafume | Dawson 100 | Detia gas ex-m | Dow Fume MC2 | Dowfume | Dowfume mc-2 | Dowfume MC-2 Fumigant | Dowfume mc-2 soil fumigant | Dowfume MC-2R | Dowfume mc-33 | Drexel plant bed gas | EDCO | Embafume | Fumigant-1 | Fumigant-1 (Obs.) | Halon 1001 | Haltox | Iscobrome | Kayafume | M-b-c Fumigant | MB | MBC soil fumigant | Mbc-33 Soil Fumigant | MBX | Meb R | MEBR | Merth-O-gas | Metafume | Meth-O-gas | Methogas | Methyl bromide | Methyl bromide as a structural fumigant | Methyl bromide rodent fumigant (with chloropicrin) | Methyl bromide | 14C-labeled | Methyl bromide | BSI | ISO | JMAF | Methyl fume | Methylbromid | Methylbromide | Metylu bromek | Monobrommethan | Monobromomethane | Pestmaster | Pestmaster (obs.) | Pestmaster Soil Fumigant-1 | Profume | Profume (obs.) | R 40B1 | Rfdfif@ | Rotox | Superior Methyl Bromide-2 | Terabol | Terr-O-cide II | Terr-O-gas | Terr-O-gas 100 | Terr-O-gas 67 | Tri-brom | Zytox
bromopropylate3
Bromoxynil+i55
2,6-Dibromo-4-cyanophenol | 3,5-Dibromo-4-hydroxybenzonitril (ACN) | 3,5-Dibromo-4-hydroxybenzonitrile | 3,5-dibromo-4-hydroxyphenyl cyanide | 3,5-Dibromo-4-hydroxyphenylcyanide | 4-Cyano-2,6-dibromophenol | 4-Hydroxy-3,5-dibromobenzonitrile | Brittox | Brominal | Brominal industrial | Brominal ME4 | Brominal plus | Brominal triple | Brominex | Brominil | Bromotril | Bromoxynil (acn) | Bromoxynil + atrazine | Bromoxynil | potassium salt | Bromoxynil | sodium salt | Bromoxynil-methyl ether | Bronate | Broxynil | Bucril | Buctril | Buctril 4EC | Buctril industrial | Buctril-atrazine | Butil chlorofos | Butilchlorofos | Butilchorofos | Certrol b | Chipco buctril | Chipco crab-kleen | Dibromo-4-cyanophenol | Dibromo-4-hydroxybenzonitrile | Dibromo-4-hydroxyphenyl cyanide | Harness | Hydroxy-3,5-dibromobenzonitrile | Labuctril | Labuctril 25 | Litarol | Litarol m | ME4 BROMINAL | Merit | Novacorn | Nu-lawn weeder | Oxytril m | PACK | Pardner | Sabre | Terset | Toplan | Torch
bromoxynil heptanoate53
Bromoxynil octanoate54
bromuconazole4
Bronopoli178
2-Bromo-1-nitro-1,3-propanediol | 2-Bromo-2-nitro-1 | 3-propanediol | 2-Bromo-2-nitro-1,3-propanediol | 2-Bromo-2-nitropropan-1,3-diol | 2-Bromo-2-nitropropane-1,3-diol | 2-Nitro-2-bromo-1 | 3-propanediol | 2-Nitro-2-bromo-1,3-propanediol | b-bromo-b-nitrotrimethyleneglycol | Beta-bromo-beta-nitrotrimethyleneglycol | Bioban BNPD-40 | Bronidiol | Bronocot | Bronopol-boots | Bronopolu | Bronosol | Bronotak | Broponol | C3H6BrNO4 | Canguard 409 | Epon(r) substitute embedding medium kit | Epoxy embedding medium kit | Lexgard bronopol | Myacide as plus | Myacide S-1 | S-2 | Onyxide 500
bupirimate4
Buprofezini5
(2Z)-2-(Tert-butylimino)-3-isopropyl-5-phenyl-1,3,5-thiadiazinan-4-one
Butafenacili3
1,1-Dimethyl-2-oxo-2-(2-propenyloxy)ethyl 2-chloro-5-[3,6-dihydro-3-methyl-2,6-dioxo-4-(trifluoromethyl)-1(2H)-pyrimidinyl]benzoate | 1,1-Dimethyl-2-oxo-2-(prop-2-en-1-yloxy)ethyl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]benzoate | 1-(Allyloxy)-2-methyl-1-oxo-2-propanyl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydro-1(2H)-pyrimidinyl]benzoate | 2-(allyloxy)-1,1-dimethyl-2-oxoethyl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]benzoate
Butralini3
butroxydim44
cadusafos4
ebufos
Captani116
Merpan | Orthocide
Carbaril+i107
1-Naphthalenol methylcarbamate | 1-Naphthalenol | methylcarbamate | 1-Naphthalenyl methylcarbamate | 1-Naphthol N-methylcarbamate | 1-Naphthyl methylcarbamate | 1-Naphthyl N-methylcarbamate | 1-Naphthyl N-methylcarbamateacid O,O-diethyl ester | 18 | Concentrat VO | a-naftyl-n-methylkarbamat | a-naphthalenyl methylcarbamate | a-naphthyl methylcarbamate | a-naphthyl n-methylcarbamate | Alpha-naphthalenyl methylcarbamate | Alpha-naphthyl methylcarbamate | Alpha-naphthyl n-methylcarbamate | alpha.Naftyl-n-methylkarbamat | alpha.Naphthalenyl methylcarbamate | alpha.Naphthyl methylcarbamate | alpha.Naphthyl n-methylcarbamate | Antigale | Arilat | Arilate | Arylam | Atoxan | Avicopharma brand of carbaril | Bercema NMC50 | Bug master | Caprolin | Carbamic acid | methyl- | naphthalenyl ester | Carbamic acid | N-methyl,1-naphthyl ester | Carbamic-14C acid | methyl- | 1-naphthyl ester | Carbamine | Carbaril avicopharma brand | Carbaril biov brand | Carbaril coophavet brand | Carbaril intraveno brand | Carbaril mavlab brand | Carbaril novartis brand | Carbaril ornis brand | Carbaril sanofi brand | Carbaril sogeval brand | Carbaril virbac brand | Carbaril vtoquinol brand | Carbarilo | Carbarilum | Carbaryl | Carbaryl (sevin) | Carbaryl solution | Carbaryl | Manganese (2+) Salt | Carbaryl | Nickel (2+) Salt | Carbatox | Carbatox 75 | Carbatox-60 | Carbatox-75 | Carbavur | Carbomate | Carbyl | Carpolin | Carylderm | Caswell No. 160 | Cekubaryl | Clinicide | Compound 7744 | Concentrat VO 18 | Coophavet brand of carbaril | Crag sevin | Crunch | David veterinary laboratories brand of carbaril | Denapon | Derbac | Devicarb | Dicarbam | Dicarbament 23,969 | Dog net insecticide poudre | Dog-net insecticide poudre | Dognet insecticide poudre | Dyna-carbyl | Experimental Insecticide 7744 | Fido's free itch | Fido's free-itch | Fido's freeitch | Flea and tick powder | G wizz | Gamonil | Gwizz | Hexavin | Insecticide moureau | poudre | Insecticide vetoquinol | poudre | Intraveno brand of carbaril | Joseph LYDDY | Karbaryl | Karbaspray | Karbatox | Karbatox 75 | Karbatox zawiesinowy | Karbosep | Kid pest project (carbaryl) (see also carbaryl) | Mavlab brand of carbaril | Menaphtam | Methylcarbamat of e 1-naphthol | Methylcarbamate 1-naphthalenol | Methylcarbamate 1-naphthol | Methylcarbamate | 1-naphthalenol | Methylcarbamic acid | 1-naphthyl ester | Microcarb | Monsur | Moureau | poudre insecticide | Mugan | Murvin | Murvin 85 | N-methyl naphthylcarbamate | N-methyl-.alpha.-naphthylcarbamate | N-methyl-.alpha.-naphthylurethan | N-Methyl-1-naphthyl carbamate | N-methyl-a-naphthylcarbamate | N-methyl-a-naphthylurethan | N-methyl-alpha-naphthylcarbamate | N-methyl-alpha-naphthylurethan | NAC | naphthalen-1-yl methylcarbamate | Naphthalenol | methylcarbamate | Naphthyl n-methylcarbamate | Noflo 5 vet | Novartis brand of carbaril | O-(1-Naphthyl)-N-methylcarbamat | Occoxil | Olititox | Oltitox | Ornis brand of carbaril | Panam | Pomex | Poudre insecticide moureau | Poudre insecticide vetoquinol | Poutic | Prosevor 85 | Ravyon | Rylam | Sanofi brand of carbaril | Savit | Seffein | Septene | Sevimol | Sevin | Sevin (carbaryl) | Sevin 4 | Sevin brand SL | Sewin | Skatta tick flea louse powder | Sogeval brand of carbaril | SOK | Suleo | Tercyl | Thinsec | Tigal | Tolyspaz | Tomado | Tornado | Toxan | Tricarnam | Union Carbide 7,744 | Vetoquinol | poudre insecticide | Vetox | Vioxan | Virbac brand of carbaril | VO 18 | Concentrat | Wasp destroyer
Carbendazim+i53
1H-Benzimidazol-2-yl-carbamic acid | methyl ester | 1H-Benzimidazol-2-ylcarbamic acid methyl ester | 1H-Benzimidazol-2-ylcarbamic acid | methyl ester | 1H-Benzimidazole-2-carbamic acid | methyl ester | 2-(Carbomethoxyamino)benzimidazole | 2-(Methoxy-carbonylamino)-benzimidazol | 2-(Methoxycarbamoyl)benzimidazole | 2-(Methoxycarbonylamino)-benzimidazole | 2-(Methoxycarbonylamino)benzimidazole | 2-(Methoxycarboxamido)benzimidazole | 2-Benzimidazolecarbamic acid | methyl ester | 2-Bezimidazolecarbamic acid methyl ester | 2-MBC | 2-Methyl benzimidazolecarbamate | 2-[(Methoxycarbonyl)amino]benzimidazole | A 118 (Pesticide) | Agrizim | Antibac MF | Battal | Bavistan | Bavistin | Bavistin 25SD | Bavistin 3460 | Bavistin 50SD | Bavistin FL | Bavistine | BCM | BCM (fungicide) | Bengard | Benzimidazole carbamate de methyle | Benzimidazole-2-carbamic acid | methyl ester | Benzimidazolecarbamate methyl ester | Benzimidazolecarbamic | Bercema-bitosen | Bitosen | BMC | BMC? | BMK | BMK (fungicide) | Carbamic acid | 1H-benzimidazol-2-yl- | methyl ester | Carbamic acid | 1H-benzimidazolyl- | methyl ester | Carbamic acid | N-1H-benzimidazol-2-yl- | methyl ester | Carben VL | Carbendazime | Carbendazin | Carbendazine | Carbendazol | Carbendazol | JMAF | Carbendazole | Carbendazym | Carbendazyme | Custos | Delsene | Delsene 10 | Derosal | Derosal 60PM | Equitdazin | Falicarben | Funaben | Funaben 3 | Funaben 50 | Fungisol | Fungoxan | Garbenda | Ipo y | Jkatein | Jkstein | Karben | Karben flo stefes | Karben stefes flo | Kemdazin | Kid pest project (carbendazim) (see also carbendazim) | Kolfugo | Kolfugo 25 FW | Kolfugo 25FW | Kolfugo extra | MBC | Mecarzole | Medamine | Mekarzole | Methoxybenzimidazole-2-carbamic acid | Methyl 1H-benzimidazol-2-ylcarbamate | Methyl 1H-benzimidazol-2-ylcarbamate (9CI) | Methyl 1H-benzimidazol-2-ylcarbamate | 9CI | Methyl 1H-benzimidazole-2-carbamate | Methyl 1H-benzimidazolylcarbamate | Methyl 2-benzimidazil carbamate | Methyl 2-benzimidazolecarbamate | Methyl 2-benzimidazolylcarbamate | Methyl benzimidazol-2-ylcarbamate | Methyl benzimidazolecarbamate | Methyl benzimidazolylcarbamate | Methyl N-2-benzimidazolecarbamate | Methyl-2-benzimidazole carbamate | Methyl-N-(2-benzimidazolyl)carbamate | Methylbenzimidazole-2-ylcarbamate | MYCO | Olgin | Olgin (fungicide) | Pillarstin | Preparation G 665 | Preventol BCM | Protek | Sarfun | SPIN | Spin (pesticide) | Stein | Stempor | Subeej | Supercarb | Thicoper | Triticol | Zhiweiling
Carbetamide+i42
(Phenylcarbamoyloxy)-2-N-ethylpropionamide | (R)-N-Ethyl-2-(((phenylamino)carbonyl)oxy)propanamide | 1-(Ethylcarbamoyl)ethyl phenylcarbamate | 2-(Ethylamino)-1-methyl-2-oxoethyl phenylcarbamate | 2-Phenyl-carbamoyloxy-N-aethyl-propionamid | Carbetamex | Carbetamid | Carbethamide | D-(-)-1-(Ethylcarbamoyl)ethyl phenylcarbamate | D-n-ethylacetamide carbanilate | D-n-ethyllactamide carbanilate | D-n-ethyllactamide carbanilate (ester) | Legurame | N-Phenyl-1-(ethylcarbamoyl-1)-ethylcarbamate | D isomer
Carbofuran+i55
2 | 3-Dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate | 2 | 3-Dihydro-2,2-dimethylbenzofuranyl-7-N-methylcarbamate | 2,2-Dimethyl-2,2-dihydrobenzofuranyl-7 N-methylcarbamate | 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-yl methylcarbamate | 2,2-Dimethyl-2,3-dihydro-7-benzofuranyl N-methylcarbamate | 2,2-Dimethyl-2,3-dihydrobenzoduranyl-7-N-methylcarbamate | 2,2-Dimethyl-7-coumaranyl N-methylcarbamate | 2,3-Dihydro-2,2-dimethyl-7-benzofuranol methylcarbamate | 2,3-Dihydro-2,2-dimethyl-7-benzofuranol N-methylcarbamate | 2,3-DIHYDRO-2,2-DIMETHYL-7-BENZOFURANOL | METHYLCARBAMATE | 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate | 2,3-Dihydro-2,2-dimethyl-7-benzofuranyl methylcarbamate | 9CI | 2,3-Dihydro-2,2-dimethylbenzofuran-7-yl methylcarbamate | 2,3-Dihydro-2,2-dimethylbenzofuranyl-7-N-methylcarbamate | 7-Benzofurano | 2,3-dihydro-2,2-dimethyl | methylcarbamate | 7-Benzofuranol | 2,3-dihydro-2,2-dimethyl- | methylcarbamate | Bay 70143 | Brifur | Carbodan | Carbofuran (pesticide/fertilizer mixture) | Carbofuran mixture | Carbofurane | Chinufur | Crisfuran | Curaterr | FMC 10242 | Furacarb | Furadan | Furadan 3G | Furadan 4f | Furadan 75 WP | Furadan g | Furadane | Furodan | Karbofuranu | Kenofuran | NEX | Niagaral 242 | Pillarfuran | Rampart | Sipcam UK carbosip 5G | Tripart nex | Yaltox
Carbon dioxide+i262
Carbon oxide | Carbon-12 dioxide | Carbonic acid anhydride | Carbonic acid gas | Carbonic anhydride
Carbosulfan+i24
Advantage | Caswell No. 463C | Dibutylaminosulfenylcarbofuran | Marshal | Marshal 10G | Marshal/suscon | Marshall | Marshall 10G | Posse | RCRA waste no. P189 | Sheriff
Carboxini5
2,3-Dihydro-5-carboxanilido-6-methyl-1,4-oxathiin | 2,3-Dihydro-6-methyl-5-phenylcarbamoyl-1,4-oxathiin | Carbathiin | Carbathiine | Carboxine | CBX | Kisvax | Vitavax
Carfentrazone-ethyli62
Affinity | Annex | Aurora | Ethyl 2-chloro-3-(2-chloro-5-[4-(difluoromethyl)-3-methyl-5-oxo-4,5-dihydro-1H-1,2,4-triazol-1-yl]-4-fluorophenyl)propanoate | Spotlight
CETRIMIDE3
chlorantraniliprole61
DPX-E2Y45, Rynaxypyr
Chlorfenapyr+i65
AC 303630 | CL 303630 | Kotetsu | Pirate | Pirate 3F | Pylon
chlorfenvinphos42
dimethylvinphos
chlorfluazuron3
Aim, atabron
chlorhexidine di(acetate)7
CHLORHEXIDINE DIHYDROCHLORIDE3
Chloridazoni52
1-Phenyl-4-amino-5-chloro-6-pyridazone | 1-Phenyl-4-amino-5-chloropyridaz-6-one | 1-Phenyl-4-amino-5-chlorpyridaz-6-one | 5-Amino-4-chloro-2,3-dihydro-3-oxo-2-phenylpyridazine | 5-amino-4-chloro-2-phenyl-2,3-dihydropyridazin-3-one | 5-Amino-4-chloro-2-phenyl-3(2H)-pyridazinone | 5-Amino-4-chloro-2-phenyl-3(2H)-pyridazone | 5-Amino-4-chloro-2-phenyl-3-pyridazinone | 5-Amino-4-chloro-2-phenyl-pyridazin-3-one | 5-amino-4-chloro-2-phenylpyridazin-3(2H)-one | 5-Amino-4-chloro-2-phenylpyridazinone | Alicep | Betoxon | Burex | Choridazone | Clorizol | PCA | Phenazon | Phenazone | Pyramin | Pyramine | Pyrazone | Suzon | Tripart gladiator
chlormequat chloride5
4-(4-Chloro-2-methylphenoxy)butanoic acid+i53
(2-Methyl-4-chlorophenoxy)butyric acid | (4-chloro-2-Methylphenoxy)butyric acid | (4-Chloro-o-tolyl)oxy]butyric acid | (4-chloro-O-Tolyloxy)butyric acid | 2,4-MCPB | 2-Methyl-4-chlorophenoxy gamma-butyric acid | 2-Methyl-4-chlorophenoxybutyric acid | 2M 4KhM | 3-Phenoxybutyric acid | 4-((4-chloro-O-Tolyl)oxy)butyric acid | 4-(2-Methyl-4-chlorophenoxy)butyric acid | 4-(4-Chloro-2-methylphenoxy)butanoate | 4-(4-chloro-2-Methylphenoxy)butanoate | 4-(4-chloro-2-Methylphenoxy)butanoic acid | 4-(4-Chloro-2-methylphenoxy)butyric acid | 4-(4-Chloro-o-tolyloxy)butyric acid | 4-(MCB) | 4-[(4-Chloro-o-tolyl)oxy]butyric acid | 4MCPB | Belmac straight | Bexane | Bexone | Can-trol | Caswell No. 558 | Fisons 18-15 | MCPB | gamma-(2-Methyl-4-chlorophenoxy)butyric acid | gamma-(4-chloro-2-Methylphenoxy)butyric acid | gamma-MCPB | Gamma-MCPB | Gamma.-(2-methyl-4-chlorophenoxy)butyric acid | Gamma.-(4-chloro-2-methylphenoxy)butyric acid | gamma.-MCPB | Legumex | MCP-butyric | MCPB | PDQ | Thistrol | Thitrol | Trifolex | Tritrol | Tropotox | Trotox | U46 MCPB | {4-[(4-chloro-O-tolyl)oxy]butyric} acid
Chlorothalonil+i107
1,3-Dicyano-2,4,5,6-tetrachlorobenzene | 1,3-Dicyanotetrachlorobenzene | 2,4,5,6-Tetrachloro-1,3-benzenedicarbonitrile | 2,4,5,6-Tetrachloro-1,3-benzenedicarbonitrile (8CI) | 2,4,5,6-Tetrachloro-1,3-benzenedicarbonitrile (8CI)(9CI) | 2,4,5,6-Tetrachloro-1,3-dicyanobenzene | 2,4,5,6-Tetrachloro-3-cyanobenzonitrile | 2,4,5,6-tetrachlorobenzene-1,3-dicarbonitrile | 2,4,5,6-Tetrachloroisophthalonitrile | 2,4:5,6-Tetrachloroisophthalonitrile | BB chlorothalonil | Bombardier | Bonide | Bravo | Bravo 500 | Bravo 6f | Bravo-W-75 | Chiltern ole | Chloroalonil | Chlorothalonil solution | Chlorothanonil | Chlorthalonil | Clortocaf ramato | Clortocaffaro | Clortosip | Contact 75 | Dacobre | Daconil | Daconil 2787 | Daconil 2787 flowable fungicide | Daconil 2787 W-75 Fungicide | Daconil 2787 W75 | Daconil flowable | Daconil m | Daconil turf | DaconilDAC-2787 | Dacosoil | Dexol fungicide containing daconil | Dragon daconil 2787 | Echo 75 | Evade | Exotherm | Exotherm termil | Faber | Farber | Ferti-lome | Forturf | Groutcide 75 | Hydroxychlorothalonil | Jupital | M-TCPN | M-tetrachlorophthalodinitrile | M-tetrachlorophthalonitrile | Meta-TCPN | Meta-tetrachlorophthalodinitrile | Nopcocide | Nopcocide N 96 | Nopcocide N-40-D | Nopcocide N-96 | Nopcocide N-96-S | Nopcocide N40D and N96 | Nuocide | OLE | Ortho Multi-Purpose Fungicide Dacon il 2787 | Ortho multi-purpose fungicide daconil 2787 | Pennington's pride multi-purpose fungicide | Pillarich | Power chlorothalonil 50 | Pro-care multi-purpose fungicide | PS1020 SUPELCO | Repulse | Security fungi-g ard | Security fungi-gard | Siclor | Sipcam UK rover 500 | Sweep | Taloberg | TCIN | Termil | Terraclactyl | Tetrachlorisoftalonitril | Tetrachloro-1,3-dicyanobenzene | Tetrachloro-m-phthalodinitrile | Tetrachloroisophthalodinitrile | Tetrachloroisophthalonitrile | Tetrachloroisophthalonitrilem-tetrachlorophthalodinitrile | TPN | TPN (pesticide) | Tripart faber | Tripart ultrafaber | Tuffcide | Vanox
chlorphthalim3
MK-616
Chlorpropham+i65
(3-Chlorophenyl)carbamic acid | 1-methylethyl ester | 1-Methylethyl (3-chlorophenyl)carbamate | 1-Methylethyl(3-chlorophenyl)carbamate | 3-Chlorocarbanilic acid | isopropyl ester | Atlas CIPC 40 | Beet-kleen | Bud nip | Bud-nip | Bygran | Carbamate | Carbamate pesticide cipc | Carbamic acid | (3-chlorophenyl)- | 1-methylethyl ester | Carbanilic acid | m-chloro- | isopropyl ester | Caswell No. 510A | Chlor ifc | Chlor ifk | Chlor ipc | Chlor ocarbanilic acid isopropyl ester | Chlor-ifc | Chloripc | Chloro ipc | Chloro-icp | Chloro-ifk | Chloro-ipc | Chlorocarbanilic acid isopropyl ester | Chloropropham | Chlorpropam | Chlorpropham cipc | Chlorprophame | Ci-ifk | Ci-ipc | CIPC | CL-ifk | Croptex chrome | Elbanil | Furloe | Furloe 3 EC | Furloe 3EC | Furloe 4EC | Furloe Chloro IPC 4EC | Furlow Chloro IPC 20G | Gro stop | Isopropyl (3-chlorophenyl)carbamate | Isopropyl 3-chlorocarbanilate | Isopropyl 3-chlorophenylcarbamate | Isopropyl chlorocarbanilate | Isopropyl m-chlorocarb anilate | Isopropyl m-chlorocarbanilate | Isopropyl meta-chlorocarbanilate | Isopropyl N-(3-Chlorophenol)carbamate | Isopropyl N-(3-Chlorophenyl) Carbamate | Isopropyl N-(3-chlorophenyl)carbamate | Isopropyl n-(m-chlorophenyl)carbamate | Isopropyl N-3-chlorophenyl | Isopropyl n-chlorophenylcarbamate | Isopropyl-m-chlorocarbanilate | Isopropyl-N-(3-chlorophenyl)carbamate | Isopropyl-N-(3-chlorphenyl)-carbamat | Isopropyl-N-3-chlorophenyl carbamate | Isopropyl-n-m-chlorophenyl-carbamate | Jack wilson chloro 51 oil | Jack Wilson chloro 51(oil) | Keim-stop | Liro cipc | m-Chlorocarbanilic acid isopropyl ester | m-Chlorocarbanilic acid | isopropyl ester | Metoxon | Mirvale | MSS cipc | N-(3-Chloor-fenyl)-isopropyl carbamaat | N-(3-Chlor-phenyl)-isopropyl-carbamat | N-(3-Chloro phenyl)carbamate d'isopropyle | N-(3-Chlorophenyl)carbamic acid | isopropyl ester | N-(3-Chlorophenyl)isopropyl carbamate | N-(3-Cloro-fenil)-isopropil-carbammato | N-3-Chlorophenylisopropylcarbamate | Nexoval | o-Isopropyl N-(3-chlorophenyl)carbamate | Prevenol | Prevenol 56 | Preventol | Preventol 56 | Preweed | Residuren | Sopropyl N-3-chlorophenyl | Sprout nip | Sprout-nip ec | Spud-nic | Spud-nie | Spud-nip | Stopgerme-s | Taterpex | Warefog
Chlorpyrifos+i95
Bonidel | Brodan | Chloropyrifos | Chloropyriphos | Chlorpyrifos-ethyl | Chlorpyriphos | Chlorpyriphos-ethyl | Chlorpyrofos | Chlorpyrophos | Coroban | Danusban | Detmol U.A. | Dowco 179 | Durmet | Dursban | Dursban 10CR | Dursban 2E | Dursban 4E | Dursban F | Dursban R | Ethyl chlorpyriphos | Geodinfos | Killmaster | Lentrek | Lorsban | m-Chlorpyrifos | O,O-Diaethyl-O-3,5,6-trichlor-2-pyridylmonothiophosphat | O,O-Diethyl O-(3,5,6-trichloro-2-pyridinyl)phosphorothioate | O,O-Diethyl O-(3,5,6-Trichloro-2-pyridyl) phosphorothioate | O,O-Diethyl O-(3,5,6-trichloropyridin-2-yl) phosphorothioate | O,O-Diethyl O-(3,5,6-trichloropyridin-2-yl) thiophosphate | O,O-Diethyl-O-(3,5,6-trichloro-2-pyridyl)phosphorothioate | Pageant | Phosphorothioic acid | O,O-diethyl O-(3,5,6-trichloro-2-pyridinyl) ester | Piridane | Pyrinex | Silrifos | Spannit | Stipend | SuSCon | Suscon blue | Suscon green | Tafaban | Terial | Trichlorpyrphos | Zidil
Chlorpyrifos-methyl+i53
Chloropyriphos-methyl | Chlorpyrifos O,O-dimethyl analog | Methyl chlorpyrifos | Methyl chlorpyriphos | O,O-Dimethyl O-(3,5,6-trichloro-2-pyridyl) phosphorothioate | O,O-Dimethyl O-(3,5,6-trichloropyridin-2-yl) thiophosphate | O,O-Dimethyl-O-(3,5,6-trichloro-2-pyridyl)phosphorothioate | Phosphorothioic acid | O,O-dimethyl O-(3,5,6-trichloro-2-pyridinyl) ester | Phosphorothioic acid | O,O-dimethyl O-(3,5,6-trichloro-2-pyridyl) ester | Trichlormethylfos
Chlorsulfuroni61
1-((o-Chlorophenyl)sulfonyl)-3-(4-methoxy-6-methyl-s-triazin-2-yl)urea | 1-(2-Chlorophenyl)sulfonyl-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | 2-Chloro-N-(((4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino)carbonyl)benzenesulfonamide | 2-Chloro-N-((4-methoxy-6-methyl-1,3,5-triazin-2-yl)aminocarbonyl)-benzenesulfonamide | 2-Chloro-N-[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]benzenesulfonamide | 2-Chloro-N-[[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]benzenesulfonamide | Finesse | Glean | Glean C | Telar | Trilixon | Tuligen | {[(2-Chlorophenyl)sulfonyl]amino}-N-(4-methoxy-6-methyl(1,3,5-triazin-2-yl))carboxamide
chlorthal-dimethyl4
Cinmethylin+i43
(±)-2-Exo-(2-methylbenzyloxy)-1-methyl-4-isopropyl-7-oxabicyclo-[2.2.1]heptane | 1-methyl-2-[(2-methylbenzyl)oxy]-4-(1-methylethyl)-7-oxabicyclo[2.2.1]heptane | 1-methyl-4-(methylethyl)-2-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane | 4-Isopropyl-1-methyl-2-[(2-methylbenzyl)oxy]-7-oxabicyclo[2.2.1]heptane | Argold | Cinch | Exo-(±)-1-Methyl-4-(1-methylethyl)-2-[(2-methylphenyl)methoxy]-7-oxabicyclo[2.2.1]heptane
clethodim5
climbazole3
Clodinafop-propargyli43
prop-2-ynyl (R)-2-[4-(5-chloro-3-fluoro-2-pyridyloxy)phenoxy]propionate | R-2-[4-[(5-Chloro-3-fluoro-2-pyridinyl)oxy]phenoxy]propanoic acid | 2-propynyl ester
Clofentezinei63
3,6-Bis(O-chlorophenyl)-1,2,4,5-tetrazine | Apollo | Bisclofentazin | Bisclofentazine
Clomazonei6
2-(2-chlorobenzyl)-4,4-dimethyl-1,2-oxazolidin-3-one | 2-(2-Chlorobenzyl)-4,4-dimethyl-3-isoxazolidinone | 2-(2-chlorobenzyl)-4,4-dimethylisoxazolidin-3-one | 2-[(2-chlorophenyl)methyl]-4,4-dimethyl-3-isoxazolidinone | Dimethazone
Clopyralidi6
3,6-Dichloro-2-pyridinecarboxylic acid | 3,6-Dichloropicolinic acid | 3,6-Dichloro-2-Pyridinecarboxylicacid | 3,6-Dichloropyridine-2-carboxylic acid | Acide 3,6-dichloropicolinique | Acide dichloro-3,6 picolinique
cloquintocet-mexyl6
closantel4
Clothianidini72
(e)-N-(2-chloro-5-Thiazolyl)methyl-n'-methyl-n''-nitroguanidine
Clotrimazole+i64
(Chlorotrityl)imidazole | 1-((2-Chlorophenyl)diphenylmethyl)-1H-imidazole | 1-(alpha-(2-Chlorophenyl)benzhydryl)imidazole | 1-(O-Chloro-alpha,alpha-diphenylbenzyl)imidazole | 1-(o-Chloro-α,α-diphenylbenzyl)imidazole | 1-(O-Chlorotrityl)imidazole | 1-(α-(2-Chlorophenyl)benzhydryl)imidazole | Canesten | Canesten 1-Day Cream Combi-Pak | Canesten 1-Day Therapy | Canesten 3-Day Therapy | Canesten 6-Day Therapy | Canesten Combi-Pak 1-Day Therapy | Canesten Combi-Pak 3-Day Therapy | Canesten Cream | Canesten Solution | Canestine | Canifug | Chlotrimazole | Clotrimaderm | Clotrimaderm Cream | Clotrimazol | Clotrimazolum | Desamix F | Empecid | Fem Care | FemCare | Fungicip | Gyne lotrimin | Gyne-lotrimin | Gyne-Lotrimin 3 | Gyne-Lotrimin 3 Combination Pack | Gyne-Lotrimin Combination Pack | Gyne-Lotrimin3 | Gyne-Lotrimin3 Combination Pack | Gynix | Lopac-C-6019 | Lotrimax | Lotrimin | Lotrimin AF | Lotrimin AF Cream | Lotrimin AF Jock-Itch Cream | Lotrimin AF Lotion | Lotrimin AF Solution | Lotrimin Cream | Lotrimin Lotion | Lotrimin Solution | Lotrisone | Mono-baycuten | Monobaycuten | Mycelax | Mycelex | Mycelex 7 | Mycelex Cream | Mycelex G | Mycelex OTC | Mycelex Solution | Mycelex Troches | Mycelex Twin Pack | Mycelex-7 | Mycelex-7 Combination Pack | Mycelex-G | Mycelex: MycosporinRimazole | Myclo Cream | Myclo Solution | Myclo Spray Solution | Myclo-Derm | Myclo-Gyne | Mycosporin | Mykosporin | Neo-Zol Cream | Otomax | Pedisafe | Prestwick_120 | Rimazole | Tibatin | Trimysten | Trivagizole 3 | Veltrim
copper octanoate4
coumatetralyl44
CPMF3
Cyanamidei64
Amidocyanogen | Carbamonitrile | Carbodiimide | Cyanoamine | H2N-C#N | NH2CN
Cyanazinei43
2-([4-chloro-6-(Ethylamino)-1,3,5-triazin-2-yl]amino)-2-methylpropanenitrile | 2-Chloro-4-(1-cyano-1-methylethylamino)-6-ethylamine-1,3,5-triazine | 2-chloro-4-(1-Cyano-1-methylethylamino)-6-ethylamino-1,3,5-triazine | 2-[[4-chloro-6-(Ethylamino)-S-triazin-2-yl]amino]-2-methylpropionitrile | Bladex | Fortrol
cyantraniliprole5
Cyclanilidei51
1-(2,4-Dichloranilino)-carbonyl-cyclopropan-1-carbonsure | 1-(2,4-dichlorophenylcarbamoyl)cyclopropancarboxylic acid | Cyclopropanecarboxamide
Cyclopropanecarboxylic acid, 3-[(1Z)-2-chloro-3,3,3-trifluoro-1-propen-1-yl]-2,2-dimethyl-, (R)-cyano(3-phenoxyphenyl)methyl ester, (1S,3S)-rel-102
CYDIA POMONELLA GRANULOSIS VIRUS3
cyflufenamid5
Cyfluthrin+i115
(R,S)-alpha-Cyano-4-fluoro-3-phenoxybenzyl-(1R,S)-cis,trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | (RS)-.alpha.-Cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS | (RS)-a-Cyano-4-fluoro-3-phenoxybenzyl (1RS,3RS | b-Cyfluthrin | BAY-FCR 1272 | Baythroid | Baythroid 2 | Baythroid h | Baythroid(r) | Baytroid | Beta-cyfluthrin | Bulldock | Caswell No. 266E | Cyfluthin | Cyfluthrine | Cyfoxylate | Cylence | Eulan SP | Responsar | Solfac | Syfrutrin
Cyhalofop-butyli51
(2R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoic acid butyl ester | (2​R)-2-[4-(​4-​cyano-​2-f​luoro​phen​oxy)​pheno​xy]​propionic acid butyl ester | (​R)-2-[4-(​4-​cyano-​2-f​luoro​phen​oxy)​pheno​xy]​propionic acid butyl ester | Butyl (2R)-2-[4-(4-cyano-2-fluoranyl-phenoxy)phenoxy]propanoate | Butyl (R)-2-[4-(4-cyano-2-fluorophenoxy)phenoxy]propanoate | Butyl​ (2R)-2-[4-(4-​cyano-2-f​luorophen​oxy)pheno​xy]propionate | Clincher | Cyhalofop Butyl | Cyhalofop butyl ester
Cypermethrin+i104
.alpha.-cypermethrin | Agrothrin | alpha-Cyano(3-phenoxyphenyl)methyl (+-)cis,trans-3-(2,2-dichlorovinyl)-2,2-dimethylcyclopropanecarboxylate | Ambush c | Ambush CY | AMMO | Ammo (pesticide) | Antiborer 3767 | Ardap | Arrivo | Asymmethrin | Barricade | Barricade (insecticide) | Barricade 10EC | Basathrin | Beta-cypermethrin | Caswell No. 268AA | Chinmix | Cis-cypermethrin | COLT | Creokhin | Cymbush | Cympa-ti | Cymperator | Cypemethrim | Cypercare | Cyperco | Cypercopal | Cyperil | Cyperkill | Cypermethrin-25EC | Cypermethrine | Cypersect | Cypor | Cyrux | Demon | Demon TC | Drago | Dysect | Ecofleece sheep dip (non-op) | Ectomin | Ectopor | Excis | Fenom | Fenom (pesticide) | Flectron | FURY | Fury insecticide | Hilcyperin | Kalif super | Kordon | Kreokhin | Mustang | Neramethrin | Neramethrin EC 50 | Nurele | Nurelle | Polytrin | Ripcord | Rycopel | Sherpa | Siperin | Supercypermethrin | Supercypermethrin forte | Theta-cypermethrin | Topclip parasol | Toppel | Ustaad | Vucht 424 | Zeta-cypermethrin | Zetagard
Cyphenothrin+i42
D.d-t-cyphenothrin | Gokilaht | S 2703 forte
Cyproconazolei53
(2RS,3RS)-2-(4-chlorophН©nyl)-3-cyclopropyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol
Cyprodinili6
2-Anilino-4-cyclopropyl-6-methylpyrimidine | 4-Cyclopropyl-6-methyl-N-phenyl-2-Pyrimidinamine | 4-Cyclopropyl-6-methyl-N-phenyl-2-pyrimidinamine | 9CI | 4-Cyclopropyl-6-methyl-N-phenylpyrimidin-2-amine | CGA 219417 | Chorus | Unix
Cyromazinei61
2,4-Diamino-6-(cyclopropylamino)-S-triazine | 2,4-Diamino-6-(cyclopropylamino)-S-triazine (8CI) | 2-Cyclopropylamino-4,6-diamino-S-triazine | Armor | Azimethiphos | CGA 72662 | Ciromazina | Citation | Cyclopropyl-1,3,5-triazine-2,4,6-triamine | Cyclopropylmelamine | Cypromazine | Cyromazin | Cyromazinum | Diamino-6-(cyclopropylamino)-S-triazine | Larvadex | Larvadex premix | N(2)-Cyclopropyl-1,3,5-triazine-2,4,6-triamine | N-Cyclopropyl-1,3,5-triazin-2,4,6-triamine | N-Cyclopropyl-1,3,5-Triazine-2,4,6-triamine | N-Cyclopropyl-1,3,5-triazine-2,4,6-triamine | 9CI | N-Cyclopropyl-2,4,6-triamino-1,3,5-triazine | N-Cyclopropylmelamine | N-Cyclopropyltriazine-2,4,6-triamine | N2-cyclopropyl-1,3,5-triazine-2,4,6-triamine | Neoprex | Neporex | Trigard | Vetrazin | Vetrazin (pesticide) | Vetrazine
2,4-D-sodium3
dalapon-sodium42
Daminozidei51
N-(Dimethylamino)succinamic acid
Dazometi95
2-Thio-3,5-dimethyltetrahydro-1,3,5-thiadiazine | 3,5-Dimethyl-1,3,5-(2H)-tetrahydrothiadiazine-2-thione | 3,5-Dimethyl-2-thionotetrahydro-1,3,5-thiadiazine | 3,5-Dimethyltetrahydro-1,3,5-2H-thiadiazine-2-thione | 3,5-Dimethyltetrahydro-1,3,5-thiadiazine-2-thione | 3,5-Dimethyltetrahydro-2H-1,3,5-thiadiazine-2-thione | Basamid | Crag 974 | Dazoberg | Dimethylformocarbothialdine | DMTT | Mylone | NSC 4737 | Tetrahydro-2H-3,5-dimethyl-1,3,5-thiadiazine-2-thione | Tetrahydro-3,5-dimethyl-2H-1,3,5-thiadiazine-2-thione | Tiazon | UCC 974
3,4-DB3
2,4-DB-dimethylammonium3
Deltamethrin+i116
(S)-cyano(3-phenoxyphenyl)methyl (1R,3R)-3-(2,2-dibromoethenyl)-2,2-dimethylcyclopropanecarboxylate | Butox | Cislin | Crackdown | Decamethrin | Decamethrine | Decis | Decis 0.5ULV | Decis 1.5ULV | Decis 2.5ULV | Dekametrin | DeltaGard | Deltagran | Deltamethrine | Esbecythrin | Glossinex 200 | K-Obiol | K-Othrin | K-Othrine | New Musigie | Phagase 1 | Suspend | Zorcis
diafenthiuron51
Diazepam+i46
7-chloro-1,3-dihydro-1-methyl-5-phenyl-2H-1,4-benzodiazepin-2-one | Diapam | Diastat | Diazemuls | Methyl diazepinone | Methyldiazepinone | Nervium | Relanium | Valium | Aenthansilive, AIupram, Alboral, Aliseum, Altensine, Alupram, Amiprol, Anksiyolin, Anlin, Ansedan, Ansiolin, Ansiolisina, Ansiomed, Ansiopas, Antenex, Anxicalm, Anxionil, Anxionit, Anxium, Anxol, Anzepam, Apaurin, Apollonset, Apozepam, Arzepam, Assival, Atarviton, Atensine, Atilen, Audium, Avazen, Avex, Azedipamin, Azedipamine, Azipam, Azepan, Baogin, Bensedin, Bentapam, Benzopin, Best, Betapam, Bialzepam, Bortalium, Britazepam, Calmaven, Calmigen, Calmociteno, Calmod, Calmovita, Calmpose, Calmtack, Canazepam, Centrazepam, Cercine, Ceregulart, Chuansuan, Compaz, Condition, Consilium, Convulmin, Corticosan, Cuadel, Curecalm, Cyclopam, Decacil Plus, Decyl, Denion, Depocalm, Deprestop, Desconet, Desloneg, Diacen, Diaceplex, Dialag, Dialar, Diam, Diano, Diapam, Diapanil, Diapax, Diapin, Diapine, Diapo, Diaquel, Diastat, Diatex, Diatran, Diaz, Diazelong, Diazem, Diazemuls, Diazep, Diazepam, Diazepan, Diazepin, Diazer, Diazetard, Diazex, Diazidem, Diazilax, Diazum, Diben, Dicepin, Dienpax, Dipam, Dipaz, Dipezona, Disopam, Distenol, Distensor, Di-Tran, Dizac, Dizam, Dizep-P, Domalium, Doval, D-Pam, Drenian, D-Tran, D-Val, Ducene, Duksen, Dupin, Duradiazepam, DZP, Elcion, Eridan, Enyoid, E-Pam, Epanalium, Eridan, Erital, Esculid, Ethipam, Euphorin, Eurosan, Evacalm, Fabotranil, Faustan, Flocepan, Frescalis, Freudal, Galendiazepam, Gewacalm, Gewakalm, Gihitan, Glutasedan, Gradual, Gubex, Hexalid, Horizon, Ifa Fonal, Ivaxzepam, Jinpanfan, Kiatrium, Klarium, Kratium, Lamcord, Lamra, Legaril, Lembrol, Lembrol, Levium, Liberetas, Lizan, Lizon, Lorinon, Lovium, Mandro, Mandrozep, Mandro-Zep, Medipam, Melode, Melpazil, Mentalium, Metamidol, Metil Gobanol, Meval, Micronoan, Morosan, Nellium, Neo Rilax, Neo-Calme, Neosorex, Nercon, Nerozen, Nervium (Turkey), Neurolytril, Neuropam, Neurosedin, Nivalen, Nixtensyn, Noam, Noan, Normabel, Notense, Novapax, Novazam, Novodipam, Novo-Dipam, Ortopsique, Pacerfin, Paceum, Pacipam, Paci-Quil, Pacitran, Pamlin, Pamizep, Paralium, Paranten, Parzam, Pax, Paxabel, Paxate, Paxel, Paxum, Pazepam, Pealkit, Placidox, Plidan, Plidex, Prantal, Pharmadine, Placidox, Plidan, Pomin, Prizem, Propam, Pro-Pam, Prozepam, Psicotran, Psicozepam, Psychopax, Q-Pam, Quetinil, Quiatril, Quietal, Quievita, Radizepam, Ranzepam, Relanium, Relansol, Relasan, Relaxedant, Relazepam, Relazepan, Reliezen, Relivan, Reliver, Remansil, Remedium, Renborin, Reposepan, Reval, Rimapam, Ripid, Rival, Ro-Azepam, Rolasedan, Rontipan, RPS Zepam, Ruhsitus, Rupediz, Saromet, Scanzepam, Scelecome, Scriptopam, Sedabenz, Sedaner, Sedapam, Sedaril, Sedipam, Sedium, Seduxen, Seelucamu, Serenack, Serenamin, Serenzin, Servizepam, Sibason, Sibazon, Sico Relax, Sicorelax, Simasedan, Sincronex, Sipam, Solis, Somit, Somasedan, Somatin, Sonacon, Stedon, Stesolid, Stesolin, Stresanyl, Stress-Pam, Sunzepan, Tablinen, Talema, TAV-12, Taximel, Tecepan, Telsomet, Tencalm, Tensium, Tensopam, Timazepam, T-Quil, Trandyn, Tranquase, Tranquil, Tranquilax, Tranquirit, Tranquit, Tranquo, Tranquo-Puren, Tranquo-Tablinen, Tranyl, Trazepam, Tropium, Umbrium, Unisedil, Usempax AP, Valax, Valaxona, Valcaps, Valclair, Valdimex, Valiapan, Valibrin, Valinex, Valinil, Valinter, Valiquid, Valisanbe, Valitran, Valium, Valiuzam, Valocordin, Valoi, Valomin, Valpam, Valrelease, Valuzepam, Valzepam, Vanconin, Vapam, Vatran, Vazen, Vazepam, Vicalma, Vidalen, Vival, Vivol, Wilpan, Winii, X-O'Spaz, Zepam, Zepaxid, Zetran, Zopam; component of Abulempax, Acordin, Adepressina, Adepsique, Anamol, Aneurol, Ansiovitam, Ansium, Arcure, Arnol 720-T, Aspam, Aspaserine, Betamed, Biogesic, Calmosedan, Calmpose, Campin, Centagesic, Centopam, Compensol, Complutine, Cuait D, Dasten-Plus, Depsodiaz, Depsonil, Diaceplex, Diapam, Diapyram, Diazeprin, Dicepin B6, Distedon, Dolanet D, Dolo Relaxedant, Doloxene, Domalium Compuesto, Dualid, Duodil, Equimood, Ergo Dolanet D, Ergo Relaxedant, Ergo Trisclin, Esbelcabs, Faradil, Faradil 200, Faradil Gas, Gamibetal plus, Gaseo 3, Gloriax, Glypoe, Gobanal, Harmomed, Hexalid, Hipofagin, Inibex, Iremisal, Irene Plus, Klevocalm, Lakpam, Lori, Metaneuron, Minorex, Moderex, Multisedil, Nadis, Neomesmar, Neo Nevrofillin, Neovale, Nifalium, Nifepam, Nitavan, Nitcalm, Nitosc, Nitravet, Nitrosun, Nofran, Noloten Complex, Numencial, Numencial Plus, Pacium, Pamalgin, Pasminox 40 Somatico, Penormin, Pertranquil, Piguin, Placidox, Plidex, Plidex T, Plidex T 100, Podium, Prazep, Psico-Retard, Psychodep, Qual, Redotex, Reladorm, Rocitens, Rocitens Forte, Rumin, Sedilit, Serenade, Sico-Relax, Silentan, Simalgin Compuesto, Spasen somatico, Spasmeridan, Spasmoctyl Somatico 40, Spasmomen somatico, Super Emagrin, Tancodep, Tepazepan, Tenil, Tenuatina, Tilpam, Tratobes, Tri-Aero-Om, Trital, Tropargal, Ulsedin, Valisal, Valpinax, Valtrax, Vincosedan, Xiconeural 3
Diazinon+i65
Agridin 60 | Alfa-tox | Antigal | Antlak | Bassadinon | Basudin | Bazuden | Bazudin | Bazudine | Ciazinon | Compass | Dacutox | Dassitox | Dazzel | Delzinon | Diagran | Dianon | Diazide | Diazinone | Diazitol | Diazol | Dicid | Diethyl 2-isopropyl-4-methyl-6-pyrimidyl thionophosphate | Diethyl dimpylatum | Dimpylate | Dipofene | Disonex | Dizictol | Diziktol | Dizinil | Dizinon | Drawizon | Dyzol | Ektoband | Exodin | Fezudin | Flytrol | Galesan | Gardentox | Isopropylmethylpyrimidyl diethyl thiophosphate | Kayazinon | Kayazol | Knox-out | Meodinon | Nedcidol | Neocidol | Neodinon | Neotsidol | Nipsan | Nucidol | O,O-Diethyl 2-isopropyl-4-methylpyrimidyl-6-thiophosphate | Oleodiazinon | Optimizer | Root guard | Sarolex | Spectracide | Spertacide | Srolex | Terminator
dibenzoyl peroxide112
Dicamba+i73
2,5-Dichloro-6-methoxybenzoic acid | 2-Methoxy-3,6-dichlorobenzoic acid | 3,6-Dichloor-2-methoxy-benzoeizuur | 3,6-Dichlor-3-methoxy-benzoesaeure | 3,6-Dichloro-2-methoxybenzoic acid | 3,6-Dichloro-O-anisic acid | Acido (3,6-dicloro-2-metossi)-benzoico | Banex | Banlen | Banvel | Banvel 4S | Banvel 4ws | Banvel CST | Banvel d | Banvel herbicide | Banvel II herbicide | Brush buster | Compound b dicamba | Dianat | Dianate | Dicambe | Fallowmaster | Kyselina 3,6-dichlor-2-methoxybenzoova | MDBA | Mediben | Metambane | Tracker | Trooper | Velsicol 58-CS-11 | Velsicol compound r
dichlofluanid42
4,5-DICHLORO-2-N-OCTYL-3(2H)-ISOTHIAZOLONE4
2,6-Dichlorobenzonitrile+i73
(14-C)2,6-Dichlorobenzonitrile | 2,6-DBN | 2,6-Dichlorbenzonitril | 2,6-Dichlorobenzoic acid nitrile | 2,6-Dichlorophenyl cyanide | 2.6-Dichlorobenzonitrile | BH prefix d | Carsoron | Casaron | Casoron | Casoron 133 | Casoron g | Casoron G-10 | Casoron G-4 | Casoron G20 SR | Casoron G4 | Casoron GSR | Casoron W-50 | Code H 133 | Cyclomec | DBN | DBN (pesticide) | DBN (the herbicide) | DCB | Decabane | Dichlobanil | Dichlobenil | Du-sprex | Dyclomec | Fydulan | Fydumas | Fydusit | Niagara 5,996 | Niagara 5006 | Norosac | Surfassol
Dichlorophene63
2,4-Dichlorophenoxyacetic acid+i83
(2 | 4-Dichlorophenoxy)acetic acid | (2,4-dichlorophenoxy)-Acetic acid | (2,4-Dichlorophenoxy)acetic acid | (2,4-Dichlorophenyloxy)acetic acid | (2,4-Dichlorphenoxy)acetic acid | (Dichlorophenoxy)acetic acid | 2,4-D | 2,4-D Mecoprop | 2,4-Dichlorophenoxyacetate | 2,4-Dichlorophenoxyethanoic acid | Agrotect | Amidox | Aminopielik 50SL | Amoxone | Aqua-Kleen | Atlas D | B-Selektonon | Barrage HF | Brush-rhap | Chipco turf herbicide D | Chipco turf herbicide quot DQuot | Chloroxone | Crop rider | Crotilin | Dacamine | Debroussaillant 600 | Decamine | Ded-Weed | Ded-Weed LV-69 | Desormone | Dezormon | Diclordon | Dicopur | Dicotox | Dinoxol | DMA-4 | Dormone | Emulsamine bk | Emulsamine E-3 | Envert 171 | Envert dt | Esteron | Esteron 44 weed killer | Esteron 76 BE | Esteron 99 | Esteron 99 concentrate | Esteron brush killer | Esterone | Esterone four | Estone | Farmco | Fernesta | Fernimine | Fernoxone | Ferxone | Foredex 75 | Formula 40 | Hedonal | Herbidal | Huragan | Ipaner | Krotiline | Lawn-keep | Macrondray | Miracle | Monosan | Mota Maskros | Moxone | Netagrone | Netagrone 600 | Pennamine | Pennamine D | Phenox | Pielik | Planotox | Plantgard | Rhodia | Salvo | Spontox | Spritz-hormin/2,4-D | Spritz-hormit/2,4-D | Super D weedone | Superormone concentre | Tiller S | Transamine | Tributon | Trinoxol | Uniso | Vergemaster | Verton | Verton 2-D | Verton 2D | Verton D | Vertron 2D | Vidon 638 | Visko-rhap | Weed tox | Weed-ag-bar | Weed-B-gon | Weed-Rhap | Weedar | Weedar-64 | Weedatul | Weedez wonder bar | Weedone | Weedone LV4 | Weedtrol
2,4-Dichlorophenoxybutyric acid+i64
(2,4-Dichlorophenoxy)butyric acid | 2,4-(Dichlorophenoxy)butyric acid | 2,4-D Butyric | 2,4-D Butyric acid | 2,4-DB | 2,4-Dichlorophenoxybutyrate | 4-(2 | 4-Dichlorophenoxy)butyric acid | 4-(2,4-DB) | 4-(2,4-Dichlorophenoxy)butanoic acid | 4-(2,4-Dichlorophenoxy)butyric acid | Butirex | Butormone | Butoxon | Butoxone | Butoxone amine | Butoxone ester | Butyrac | Butyrac 118 | Butyrac 200 | Butyrac ester | Campbell's DB straight | Caswell No. 316 | Dichlorophenoxy)butyric acid | Embutone | Embutox | Embutox e | Embutox klean-up | gamma-(2,4-Dichlorophenoxy)-butanoic acid | gamma-(2,4-Dichlorophenoxy)-butyric acid | gamma-(2,4-Dichlorophenoxy)butanoic acid | gamma-(2,4-Dichlorophenoxy)butyric acid | Legumex | Legumex d | Sys 67 Buratal | Venceweed
1,3 - Dichloropropene (technical - grade)i64
dichlorprop-P51
Dichlorvos+i77
2,2-Dichloroethenol dimethyl phosphate | 2,2-Dichloroethenyl dimethyl phosphate | 2,2-Dichloroethenyl phosphoric acid dimethyl ester | 2,2-Dichlorovinyl alcohol dimethyl phosphate | 2,2-Dichlorovinyl dimethyl phosphate | 2,2-Dichlorovinyl dimethyl phosphoric acid ester | 2,2-Dichlorovinyl-O,O-dimethyl phosphate | 2,2-Dimethyldichlorovinyl phosphate | Algard | Apavap | Aquaguard | Astrobot | Atgard | Benfos | Bibesol | Brevinyl | Canogard | Cekusan | Chlorvinphos | Cyanophos | Cypona | DDVP | Dichloroethenyl dimethyl phosphate | Dichlorophos | Diclorvos | Dimethyl 2,2-dichloroethenyl phosphate | Dimethyl 2,2-dichlorovinyl phosphate | Dimethyl dichlorovinyl phosphate | Dimethyl O,O-dichlorovinyl-2,2-phosphate | Dimethyl-2,2-dichlorovinyl phosphate | Dimethyldichlorovinyl phosphate | Divipan | Duravos | Equigand | Equigard | Equigel | Equiguard | Ethenol | 2,2-dichloro- | dimethyl phosphate | Fecama | Herkal | Herkol | Insectigas D | Krecalvin | Lindan | Lindanmafu | Nerkol | Nogos | Novotox | Nuvan | O,O-Dimethyl 2,2-dichlorovinyl phosphate | O,O-Dimethyl dichlorovinyl phosphate | O-(2,2-Dichloroethenyl) O,O-dimethyl phosphate | O-(2,2-Dichlorvinyl)-O,O-dimethylphosphate | Panaplate | Phosphoric acid 2,2-dichloroethenyl dimethyl ester | Phosphoric acid 2,2-dichlorovinyl dimethyl ester | Phosvit | Tetravos | Topanol | Unifos | Unitox | Vapona | Verdican | Verdipor | Verdisol
Diclofop-methyli44
2-(4-(2,4-Dichlorophenoxy)phenoxy)propanoic acid methyl ester | 2-[4-(2,4-Dichlorophenoxy)phenoxy]propanoic acid | methyl ester | Dichlofopmethyl | Dichlordiphenprop | Dichlorfop-methyl | Diclofop methyl ester | Hoe-grass | Hoegrass | Hoelon | Hoelon 3EC | Illoxan | Methyl 2-[4-(2,4-Dichlorophenoxy)phenoxy]propionate | Methyl diclofop | Methyldiclofop
Dicofol+i55
1,1-Bis(4-chlorophenyl)-2,2,2-trichloroethanol | 1,1-Bis(chlorophenyl)-2,2,2-trichloroethanol | 1,1-Bis(p-Chlorophenyl)-2,2,2-trichloroethanol | 1,1-bis-(chlorophenyl)-2,2,2-trichloroethanol | 1,1-Bis-(p-chlorophenyl)-2,2,2-trichloroethanol | 2,2,2-Trichloro-1,1-bis(4-chlorophenyl)ethanol | 2,2,2-Trichloro-1,1-bis(p-chlorophenyl)ethanol | 2,2,2-Trichloro-1,1-di(4-chlorophenyl)ethanol | 2,2,2-Trichloro-1,1-di-(4-chlorophenyl)ethanol | 4,4'-Dichloro-.alpha.-(trichloromethyl)benzhydrol | 4,4'-Dichloro-a-(trichloromethyl)benzhydrol | 4,4'-Dichloro-alpha-(trichloromethyl)benzhydrol | 4-chloro-alpha-(4-Chlorophenyl)-alpha-(trichloromethyl)benzenemethanol | Acarin | Bis(chlorophenyl)-2,2,2-trichl oroethanol | Bis(chlorophenyl)-2,2,2-trichloroethanol | Carbax | Carbox | Cekudifol | Decofol | Di-(p-chlorophenyl)trichloromethylcarbinol | Dichlorokelthane | Dicomite | DTMC | Fumite dicofol | Hifol | Hilfol | Keltane | Kelthane | Kelthane a | Kelthane dust base | Kelthanethanol | Kelthone | Mifol | Milbol | Mitigan | p,p'-di cofol | p,p'-dicofol | p,p'-kelthane | p,p-dicofol | Para,para'-kelthane | Tricofol
dicyclanil5
diethamquat3
Diethyltoluamidei82
3-Methyl-N,N-diethylbenzamide | Autan | Deet | Detamide | Diethyl toluamide | Diethyltoluamidum | Dietiltoluamida | Flypel | Metadelphene | Muscol | Off | Repel
Difenacoum+i65
Difenakum | Diphenacoum | Neosorexa | Neosorexa PP580 | Ratak
Difenoconazolei6
Difenoconazol
difethialone7
Diflubenzuroni62
1-(4-Chlorophenyl)-3-(2,6-difluorobenzoyl)urea | 1-(p-Chlorophenyl)-3-(2,6-difluorobenzoyl)-Urea | 1-(p-Chlorophenyl)-3-(2,6-difluorobenzoyl)urea | Astonex | Difluron | Dimilin | Dimilin G1 | Dimilin G4 | Dimilin ODC-45 | Dimilin WP-25 | Dioflubenzuron | Duphacid | Larvakil | Micromite | N-(((4-Chlorophenyl)amino)carbonyl)-2,6-difluorobenzamide | N-(4-Chlorophenyl)-N'-(2,6-difluorobenzoyl)urea | N-(4-Chlorophenylcarbamoyl)-2,6-difluorobenzamide | N-[(4-Chlorophenyl)carbamoyl]-2,6-difluorobenzamide | N-[[(4-Chlorophenyl)amino]carbonyl]-2,6-difluorobenzamide | 9CI | N-[[(4-Chlorophenyl)amno]carbonyl]-2,6-difluorobenzamide | Philips-duphar PH 60-40 | Thompson Hayward 6040 | Thompson-Hayward 6040 | Thompson-hayward TH6040
diflufenican51
diflufenicanil
dimethenamid-P6
Dimethipin31
dimethirimol3
Dimethoate+i74
2-Dimethoxyphosphinothioylthio-N-methylacetamide | Cygon | Cygon 2-E | Cygon 400 | Cygon 4E | Cygon insecticide | Daphene | De-fend | Demos-L40 | Devigon | Dimate 267 | Dimetate | Dimethoate 30 EC | Dimethoate solution | Dimethogen | Dimethoic acid | Dimethyl S-((methylcarbamoyl)methyl) phosphorodithioate | Dimethyl S-(N-(methylcarbamoyl)methyl) phosphorodithioate | Dimeton | Dimevur | Ferkethion | Fortion NM | Fosfamid | Fosfatox R | Fosfotox | Fosfotox R | Fosfotox R 35 | Fostion MM | Lurgo | Maxima phlanzenschutz | O,O-dimethyl methylcarbamoylmethyl phosphorodithioate | O,O-dimethyl S-((methylcarbamoyl)methyl)phosphorodithioate | O,O-dimethyl S-(N-methylcarbamoylmethyl) dithiophosphate | O,O-dimethyl S-(N-methylcarbamoylmethyl) phosphorodithioate | O,O-dimethyl S-(N-methylcarbamylmethyl) thiothionophosphate | O,O-dimethyl S-methylcarbamoylmethyl phosphorodithioate | O,O-Dimethyl S-[2-(methylamino)-2-oxoethyl] dithiophosphate | O,O-Dimethyl-S-(2-oxo-3-aza-butyl)-dithiophosphate | Perfecthion | Perfekthion | Phosphamid | Phosphamide | Phosphorodithioic acid | O,O-dimethyl S-(2-(methylamino)-2-oxoethyl) ester | Racusan | Rebelate | Rogodan | Rogor | Rogor 20L | Rogor 40 | Rogor l | Rogor p | Roxion | Roxion ua | S-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate | Sevigor | Sinoratox | Sistemin | Solut | Systemic insecticide | Systemin | Systoate | Trimetion | Turbair
Dimethomorphi61
3-(4-Chlorophenyl)-3-(3,4-dimethoxyphenyl)-1-morpholinoprop-2-en-1-one | E-Dimethomorph
Dimethyl sulfoxide+i84
(CH3)2SO | (methylsulfinyl)methane | Dimethyl sulfoxixde | Dimethyl sulfur oxide | Dimethyl sulphoxide | Dimethyl sulpoxide | Dimethyli sulfoxidum | Dimethylsulfoxid | Dimethylsulfoxyde | Dimetil sulfoxido | DMSO | Methylsulfinylmethane | Rimso-50 | S(O)Me2 | Sulfinylbis(methane)
Diniconazolei3
Diclopentezol | (Z)-1-(2,4-dichlorophenyl)-4,4-dimethyl-2-(1,2,4-triazol-1-yl)pent-1-en-3-ol | MITAZOLE
Dinocap54
DPC, meptyldinocap
diphacinone53
diphacin, diphenadione
Diphenylaminei114
(phenylamino)-Benzene | (phenylamino)benzene | 2-Biphenylyl-N-pyridyl-Acetamide | 2-Biphenylyl-N-pyridylacetamide | Anilino-Benzene | Anilinobenzene | Benzenamine | N-phenyl- | styrenated | Big dipper | C6H5-NH-C6H5 | Deccoscald 282 | DFA | Difenylamin | Diphenpyramide | Diphenyl-amine | Diphenylamine indicator | Diphenylamine | acs | Diphenylamine | reaction product with 2,2,4-trimethylpentene | N,N-Diphenylamine | N-Fenylanilin | N-Phenyl-Aniline | N-Phenyl-Benzenamine | N-Phenylaniline | N-Phenylbenzenamine | N-Phenylbenzenamine | 9CI | N-Phenylbenzenamine | styrenated | N-Phenylbenzeneamine | Naugalube 428L | No scald | No scald dpa 283 | No-scald | No-Scald DPA 283 | Phenylaniline | Poly(diphenylamine) | Pyridyl-biphenylyl-acetamide | Scaldip | Shield dpa | Styrenated diphenylamine | Styrene | reaction product with diphenylamine
Diquat dibromidei74
1,1'-Ethylene 2,2'-dipyridylium dibromide | 6,7-Dihydrodipyrido[1,2-a:2',1'-c]pyrazinediium dibromide | 1,1'-Ethylene-2,2'-bipyridyldiylium dibromide
dithianon51
Dithiopyri5
Dimension (herbicide) | S,S'-Dimethyl 2-difluoromethyl-4-isobutyl-6-trifluoromethylpyridine-3,5-dicarbothioate | S3,S5-Dimethyl 2-(difluoromethyl)-4-isobutyl-6-(trifluoromethyl)-3,5-pyridinedicarbothioate | 3,5-Pyridinedicarbothioic acid | 2-(difluoromethyl)-4-(2-methylpropyl)-6-(trifluoromethyl)- | 3,5-dimethyl ester
Diuroni76
1,1-Dimethyl-3-(3,4-dichlorophenyl)urea | 1-(3,4-Dichlorophenyl)-3,3-dimethylurea | 1-(3,4-Dichlorophenyl)-3,3-dimethyluree | 3-(3,4-Dichlor-phenyl)-1,1-dimethyl-harnstoff | 3-(3,4-Dichloro-phenyl)-1,1-dimethyl-urea | 3-(3,4-Dichlorophenyl)-1,1-dimethylurea | DCMU | DCMU (3-(3,4-dichlorophenyl)-1,1-dimethylurea) | N'-(3,4-dichlorophenyl)-N,N-dimethylurea | N,N,-Dimethyl-n'-(3,4-dichlorophenyl)urea | N-(3,4-Dichlorophenyl)-n',n'-dimethylurea
doramectin5
EBEP3
ECONAZOLE NITRATE52
Emamectin benzoatei5
Anofuro[4,3,2-pq][2,6]benzodioxacyclooctadecine-13,2'-pyran]-7-yl 2,6-dideoxy-3-O-methyl-4-O-[2,4,6-trideoxy-3-O-methyl-4-(methylammonio)-a-L-arabino-hexopyranosyl]-a-L-arabino-hexopyranoside benzoate
endothal22
endothall
Enilconazolei62
(+ or -)-1-(beta-allyloxy-2,4-dichlorophenylethyl)imidazole | (+-)-1-(beta-(Allyloxy)-2,4-dichlorophenethyl)-imidazole | 1-(2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl)-1H-imidazole | 1-[2-(2,4-Dichlorophenyl)-2-(2-propenyloxy)ethyl]-1H-imidazole | 9CI | 1-[2-(Allyloxy)-2-(2,4-dichlorophenyl)ethyl]-1H-imidazole | Allyl-1-(2,4-dichlorophenyl)-2-imidazol-1-ylethyl ether | Bromazil | Chloramizol | Clinafarm | Deccozil | Deccozil S 75 | Deccozil S75 | Enilconazol | Enilconazole (BPC) | Eniloconazol | Eniloconazol (SP) | Fecundal | Flo Pro IMZ | Florasan | Freshguard | Fung-azil | Fungaflor | Fungazil | Imaverol | Imaversol | Imazalil | Imazalil (enilconazole) | Imazalil mononitrate | Imazalil phosphate | Imazalil sulfate | Imazalil sulfate (1:1) | Imazalil sulphate | Imazalil sulphate (1:1) | Imazalil | ANSI | BSI | ISO | Magnate | Nuzone | R 23979 | Rappor plus
Epoxiconazole41
eprinomectin4
B1a, B1b
Esfenvalerate+i115
Asana | Asana XL | Esfenvaleric acid | Fenvalerate (s,s)-isomer | Fenvalerate a | Fenvalerate a a | Halmark | S 5602 A a | Sumi-a | Sumi-alfa | Sumicidin a a
Ethametsulfuron methyli4
Benzoic acid | 2-[[[[[4-ethoxy-6-(methylamino)-1,3,5-triazin-2-yl]amino]carbonyl]amino]sulfonyl]- | methyl ester | ETHAMETSULFURON METHYL ESTER | Ethametsulfuron methyl | Methyl 2-((4-ethoxy-6-methylamino-1,3,5-triazin-2-yl)carbamoylsulfamoyl)benzoate
Ethephon+i63
2-Cepa | 2-Chloraethyl-phosphonsaeure | 2-Chloroethanephosphonic acid | Acide chloro-2-ethyl-phosphonique | Chloroethylphosphonic acid
Ethion+i55
Bis(s-(diethoxyphosphinothioyl)mercapto)methane | Diethion | Embathion | Ethanox | Ethiol | Ethodan | Ethopaz | Ethyl methylene phosphorodithioate | Fosfatox e | Fosfono 50 | Hylemax | Hylemox | Itopaz | O,O,O',O'-tetraethyl S,S'-methanediyl bis(dithiophosphate) | O,O,O',O'-tetraethyl S,S'-methylene bis(dithiophosphate) | O,O,O',O'-tetraethyl S,S'-methylene bisphosphorodithioate | O,O,O',O'-tetraethyl S,S'-methylene di(phosphorodithioate) | O,O,O',O'-tetraethyl S,S'-methylenebis(phosphorodithioate) | O,O,O',O'-tetraethyl S,S'-methylenebisphosphordithioate | O,O,O',O'-tetraethyl-S,S'-methylene di(phosphorodithioate) | O,O,O',O'-tetraethyl-S,S'-methylenebisphosphorodithioate | O,O,O,O-tetraethyl S,S'-methylenebis(dithiophosphate) | Phosphotox e | Rhodiacide | Rhodocide | Rodocid | Rodocide | RP-thion | S,S'-methylene bis(o,o-diethyl phosphorodithioate) | S,S'-methylene O,O,O',O'-tetraethyl di(phosphorodithioate) | S,S'-methylene O,O,O',O'-tetraethyl phosphorodithioate | Soprathion | Tetraethyl S,S'-methylene bis(phosphorothiolothionate) | Trecator-SC | Vegfru fosmite | Vegfru-fosmite
Ethofumesatei61
(RS)-2-ethoxy-2,3-dihydro-3,3-dimethylbenzofuran-5-yl methanesulfonate | 2-ethoxy-2,3-dihydro-3,3-dimethyl-5-benzofuranyl methanesulfonate | Ethofumesic acid | methanesulfonic acid (2-ethoxy-3,3-dimethyl-2H-benzofuran-5-yl) ester
ethoxysulfuron41
ethyl N-acetyl-N-butyl-?-alaninate6
Etodolac43
Etoxazolei72
(RS)-5-tert-butyl-2-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenetole | 2-(2,6-Difluorophenyl)-4-(4-(1,1-dimethylethyl)-2-ethoxyphenyl)-4,5-dihydrooxazole
Etridiazolei65
5-Ethoxy-3-(trichloromethyl)-1,2,4-thiadiazole | 5-Ethoxy-3-trichloromethyl-1,2,4-thiadiazol | Aaterra | Banrot | Dwell | Echlomezol | Ethazol | Ethazole | Ethyl 3-(trichloromethyl)-1,2,4-thiadiazol-5-yl ether | Koban | Pansoil | Planvate | Terracoat | Terraflo | Terrazole | Truban
Eugenoli171
1-Hydroxy-2-methoxy-4-allylbenzene | 1-Hydroxy-2-methoxy-4-prop-2-enylbenzene | 1-Hydroxy-2-methoxy-4-propenylbenzene | 2-Hydroxy-5-allylanisole | 2-Methoxy-1-hydroxy-4-allylbenzene | 2-Methoxy-4-(2-propenyl)phenol | 2-Methoxy-4-(3-propenyl)phenol | 2-Methoxy-4-(prop-2-en-1-yl)phenol | 2-Methoxy-4-allylphenol | 2-Methoxy-4-prop-2-enylphenol | 4-Allyl-1-hydroxy-2-methoxybenzene | 4-Allyl-2-methoxy-Phenol | 4-Allyl-2-methoxyphenol | 4-Allylcatechol 2-methyl ether | 4-Allylcatechol-2-methyl ether | 4-Allylguaiacol | 4-Hydroxy-3-methoxy-1-allylbenzene | 4-Hydroxy-3-methoxyallylbenzene | 5-Allylguaiacol | Allylguaiacol | Caryophyllic acid | Engenol | Eugenic acid | Eugenol (natural) | P-Allylguaiacol | P-Eugenol | Synthetic eugenol
Fenamiphos+i54
BAY SRA 3886 | Ethyl 3-methyl-4-(methylthio)phenyl 1-methylethylphosphoramidate | 9CI | Ethyl 3-methyl-4-(methylthio)phenyl isopropylamidophosphate | Ethyl 4-(methylthio)-m-tolyl isopropylphosphoramidate | Ethyl 4-(methylthio)m-tolyl isopropylphosphoroamidate | Ethyl 4-methylthio-m-tolyl isopropylphosphoramidate | 8CI | Ethyl-4-(methylthio)-m-tolyl isopropylphosphoramidate | m-Cresol | 4-(methylthio)- | ethyl isopropylphosphoramidate | Methaphenamiphos | Nemacur | Nemacur p | Phenamifos sulfoxide | Phenamiphos
Fenarimoli54
(2-Chlorophenyl)(4-chlorophenyl)(pyrimidin-5-yl)methanol | (2-Chlorophenyl)(4-chlorophenyl)-5-pyrimidinylmethanol | (2-Chlorophenyl)(4-chlorophenyl)5-pyrimidinylmethanol | (2-Chlorophenyl)(4-chlorophenyl)pyrimidin-5-ylmethanol | (2-Chlorophenyl)-α-(4-chlorophenyl)-5-pyrimidinemethanol | (2-Chlorphenyl)(4-chlorphenyl)-5-pyrimidinylmethanol | (2-Chlorphenyl)(4-chlorphenyl)pyrimidin-5-ylmethanol | (4-Chloro-phenyl)-(2-chloro-phenyl)-pyrimidin-5-yl-methanol | (±)-2,4'-Dichloro-α-(pyrimidin-5-yl)benzhydryl alcohol | 2,4'-Dichloro-α-(pyrimidin-5-yl)benzhydryl Alcohol | Fenarimol | Rimidin | Rubigan
Fenbuconazolei62
4-(4-chlorophenyl)-2-phenyl-2-(1H-1,2,4-triazol-1-ylmethyl)butyronitrile | alpha--[2-(4-chlorophenyl)ethyl]-a-phenyl-1H-1,2,4-triazole-1-propanenitrile
Fenhexamidi61
Decree | Elevate | Fenhexamide | N-(2,3-Dichloro-4-hydroxyphenyl)-1-methylcyclohexanecarboxamide | Teldor
Fenitrothion+i54
Accothion | Aceothion | Agriya 1050 | Agrothion | Akotion | American cyanamid cl-47,300 | Arbogal | Bayer S 5660 | Bis-Fenitrothion | Cekutrothion | Cyfen | Cytel | Cyten | Dicofen | Dimethyl 3-methyl-4-nitrophenyl phosphorothionate | Dimethyl 4-nitro-m-tolyl phosphorothionate | Falithion | Fenitox | Fenitrotion | Folithion | Folithion ec 50 | Kotion | Macbar | MEP | MEP (Pesticide) | MEP (Phosphorus insecticide) | Metathio E-50 | Metathion | Metathion E-50 | Metathione | Metathionine | Metathionine E-50 | Metation | Metation E-50 | Methylnitrophos | Mglawik F | Nitrophos | Novathion | Nuvanol | O,O-DiMe O-(3-methyl-4-nitrophenyl) thiophosphate | O,O-Dimethyl O-(3-methyl-4-nitrophenyl) phosphorothioate | O,O-Dimethyl O-(3-methyl-4-nitrophenyl) thiophosphate | O,O-Dimethyl O-(3-methyl-4-nitrophenyl)phosphorothioate | O,O-Dimethyl O-(4-nitro-3-methylphenyl)thiophosphate | O,O-Dimethyl O-4-nitro-m-tolyl phosphorothioate | O,O-Dimethyl O-4-nitro-m-tolyl thiophosphate | O,O-Dimethyl-O-(3-methyl-4-nitro-phenyl)-monothiophosphate | O,O-Dimethyl-O-(3-methyl-4-nitrofenyl)-monothiofosfaat | O,O-Dimethyl-O-(4-nitro-5-methylphenyl)-thionophosphate | O,O-Dimetil-O-(3-metil-4-nitro-fenil)-monotiofosfato | O,O-Dimetil-O-(3-metil-4-nitrofenil) fosforotioato | Oleometathion | Oleosumifene | Ovadofos | Owadofos | Owadophos | Pennwalt C-4852 | Phenitrothion | Sumifene | Sumigran | Sumithian | Sumithion | Sumitomo S-1102A | Tionfos 50 LE | Verthion
fenoxaprop-P-ethyl5
Fenoxycarb+i53
(2-(4-Phenoxyphenoxy)ethyl)carbamic acid ethyl ester | 2-(4-(Phenoxy-phenoxy)ethyl)carbamic acid ethyl ester | Carbamic acid | (2-(4-phenoxyphenoxy)ethyl)- | ethyl ester | Carbamic acid | (2-(4-phenoxyphenyl)ethyl)- | ethyl ester | Caswell No. 652C | Ethyl (2-(4-phenoxyphenoxy)ethyl)carbamate | Ethyl (2-(p-phenoxy)ethyl)carbamate | ethyl (2-(p-phenoxyphenoxy)ethyl)carbamate | Ethyl 2-(4-phenoxyphenoxy)ethylcarbamate | ethyl [2-(4-phenoxyphenoxy)ethyl]carbamate | ethyl(2-(4-phenoxyphenoxy)ethyl)carbamate | Ethyl(2-(p-phenoxyphenoxy)ethyl)carbamate | Fenasulam | Insegar | Logic | N-(2-(P-Phenoxyphenoxy)ethyl)carbamic acid | O-Ethyl N-[2-(4-phenoxyphenoxy)ethyl]carbamate | Pictyl | Pyctyl | Torus | Varikill
fenpyroximate71
Fenthion+i57
4-Methylmercapto-3-methylphenyl dimethyl thiophosphate | Mercaptophos | MPP | O,O-Dimethyl O-4-(methylmercapto)-3-methylphenyl phosphorothioate | O,O-Dimethyl O-4-methylthio-m-tolyl phosphorothioate | O,O-Dimethyl O-[3-methyl-4-(methylsulfanyl)phenyl] thiophosphate | O,O-Dimethyl-O-4-(methylmercapto)-3-methylphenyl thiophosphate | Phosphorothioic acid | O,O-dimethyl O-(3-methyl-4-(methylthio)phenyl) ester
Fenvalerate+i53
a-Cyano-3-phenoxybenzyl 2-(4-chlorophenyl)-3-methylbutyrate | Agrofen | alpha-Cyano-3-phenoxybenzyl 2-(4-chlorophenyl)isovalerate | Aqmatrine | Asana | Belmark | Cyano(3-phenoxyphenyl)methyl 4-chloro-a-(1-methylethyl)benzeneacetate | 9CI | Ectrin | Esfenvalerate | Evercide 2362 | Fenaxin | Fenkem | Fenkill | Fenoxin | Fenval | Fenvaleric acid | Phenoxin | Phenvalerate | Pydrin | Sumicidin
Fipronili106
(RS)-5-amino-1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4- (trifluoromethylsulfinyl)-1H-pyrazole-3-carbonitrile | Fluocyanobenpyrazole | Termidor
flamprop-M-methyl3
flamprop-methyl3
flazasulfuron61
flocoumafen44
flonicamid63
florasulam51
Fluazifop-P-butyli53
2-(4-((5-(Trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid butyl ester | 2-(4-((5-(Trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoic acid | butyl ester | 2-[4-[[5-(Trifluoromethyl)-2-pyridinyl]oxy]phenoxy]propanoic Acid Butyl Ester | Butyl (RS)-2-(4-((5-(trifluoromethyl)-2-pyridinyl)oxy)phenoxy)propanoate | Butyl 2-(4-((5-(trifluoromethyl)-2-pyridyl)oxy)phenoxy)propionate | Butyl 2-(4-([5-(trifluoromethyl)-2-pyridinyl]oxy)phenoxy)propanoate | Butyl 2-(4-{[5-(trifluoromethyl)-2-pyridinyl]oxy}phenoxy)propanoate | Butyl 2-(4-{[5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate | Butyl 2-[4-(5-Trifluoromethyl-2-pyridyloxy)phenoxy]propionate | Fluazifop butyl | Fluazifop-p butyl | Fusilade | Halokon | Onecide
Fluazinam+i62
3-Chloro-N-(3-chloro-5-trifluoromethyl-2-pyridyl)-α,α,α-trifluoro-2,6-dinitro-p-toluidine | 3-Chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)-2-pyridinamine | 3-chloro-N-[3-chloro-2,6-dinitro-4-(trifluoromethyl)phenyl]-5-(trifluoromethyl)pyridin-2-amine | Fluazinan | Frowncide | Shirlan Flow | [3-Chloro-2,6-dinitro-4-(trifluoromethyl)phenyl][3-chloro-5-(trifluoromethyl)(2-pyridyl)]amine
fluazuron4
flubendiamide61
Fludioxonili51
3-(2,2-Difluoro-benzodioxol-4-yl)-4-cyanopyrrole | Fludioxonil | 4-(2,2-difluoro-1,3-benzodioxol-4-yl)-1H-pyrrole-3-carbonitrile
flufenoxuron3
Flumethrin+i53
Bayticol
Flumetsulami3
Broadstrike | N-(2,6-Difluorophenyl)-5-methyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | N-(2,6-Difluorophenyl)-5-methyl[1,2,4]triazolo-[1,5-a]pyrimidine-2-sulfonamide | N-(2,6-Difluorophenyl)-5-methyl[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide
Flumiclorac-pentyli4
Flumiclorac pentyl | Flumiclorac-pentyl | ANSI | BSI | Resource | S 23031 | Sumiverde | V 23031
Flumioxazini62
2-[7-Fluoro-3,4-dihydro-3-oxo-4-(2-propynyl)-2H-1,4-benzoxazin-6-yl]-4,5,6,7-tetrahydro-1H-isoindole-1,3(2H)-dione | 9CI | EINECS Annex I Index 613-166-00-X | S 53482 | Sumisoya | V 53482
Fluometuroni41
1,1-Dimethyl-3-[3-(trifluoromethyl)phenyl]urea | N,N-dimethyl-N'-[3-(trifluoromethyl)phenyl]urea
flupropanate-sodium3
fluquinconazole54
Fluroxypyr-meptyli41
1-Methylheptyl ((4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy)acetate | 1-Methylheptyl (4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy)acetate | 1-Methylheptyl [(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate | 2-Octanyl [(4-amino-3,5-dichloro-6-fluoro-2-pyridinyl)oxy]acetate | Fluroxypyr 1-methylheptyl ester | Fluroxypyr methyl heptyl | methylheptyl 2-(4-amino-3,5-dichloro-6-fluoro-2-pyridyloxy)acetate | octan-2-yl 2-[(4-amino-3,5-dichloro-6-fluoropyridin-2-yl)oxy]acetate | Spotlight | Starane | [(4-amino-3,5-dichloro-6fluoro-2-pyridinyl)oxy]acetic acid
Flusilazole+i44
1-[[Bis(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole | 9CI | Bis(4-fluorophenyl)methyl(1H-1,2,4-triazol-1-ylmethyl)silane | DPD 78710F | DPX-N6573 | Flusilazol | Fluzilazol | Nustar | Olymp | PPX-H6573 | Punch | Punch (pesticide) | Punch 40EC | Sanction
Flutolanili5
Folistar | Moncut | N-(3-Isopropoxyphenyl)-2-(trifluoromethyl)benzamide | N-[3-(Propan-2-yloxy)phenyl]-2-(trifluoromethyl)benzamide | N1-(3-Isopropoxyphenyl)-2-(trifluoromethyl)benzamide | o-Trifluoromethyl-m'-isopropoxybenzoic anilide | Prostar
flutriafol6
fluxapyroxad5
foramsulfuron5
Forchlorfenuroni63
1-(2-chloro-4-pyridinyl)-3-phenylurea | 1-(2-chloro-4-pyridyl)-3-phenylurea | N-(2-chloro-4-pyridinyl)-N'-phenylurea | N-(2-chloro(4-pyridyl))(phenylamino)carboxamide
Fosetyl-al51
furalaxyl3
Furathiocarb+i45
2,3-Dihydro-2,2-dimethyl-7-benzofuranyl 2,4-dimethyl-5-oxo-6-oxa-3-thia-2,4-diazadecanoate | Butyl 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N,N-dimethyl-N,N-thiodicarbamate | Deltanet | Deltanit | Promet | Promet 660SCO
gibberellic acid6
glufosinate-ammonium54
glyphosatei64
3433 [GLYPHOSATE ISOPROPYLAMINE] (salt), N-(Phosphonomethyl)glycine, Glyphosphate, Glycine, N-(phosphonomethyl)-, Roundup, Pondmaster
glyphosate-trimesium22
guazatine acetates2
Guthion+i55
3-(Mercaptomethyl)-1,2,3-benzotriazin-4(3H)-one | O,O-dimethyl phosphorodithioate | Azimil | Azinfos-methyl | Azinophos-methyl | Azinphos | Azinphos methyl | Azinphos methyl mixture | Azinphos-me | Azinphos-metile | Azinphosmethyl | Beetle buster | Benzotriazinedithiophosphoric acid dimethoxy ester | Carfene | Cotneon | Cotnion | Cotnion methyl | Crysthyon | Dimethyl dithiophosphoric acid N-methylbenzazimidyl ester | Dimethyldithiophosphoric acid N-methylbenzazimide ester | Go thnion | Gothnion | Gusathion | Gusathion methyl | Gusthion m | Guthion (azinphos-methyl) | Guthion mixture | Guthion(r) | Guthion | gusation | Gution | Metazintox | Methyl azinphos | Methyl gusathion | Methyl guthion | Methylazinphos | Methylgusathion | Methyltriazotin | Metiltriazotion | N-Methylbenzazimide | dimethyl dithiophosphoric acid ester | N-methylbenzazimide | dimethyldithiophosphoric acid ester | Nitrinal | O,O-Dimethyl S-(3,4-dihydro-4-keto-1,2,3-benzotriazinyl-3-methyl) dithiophosphate | O,O-dimethyl S-(be nzaziminomethyl) dithiophosphate | O,O-dimethyl S-(benzaziminomethyl) dithiophosphate | O,O-Dimethyl S-[(4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl] dithiophosphate | O,O-Dimethyl-S-(4-oxobenzotriazin-3-methyl)-dithiophosphat | O,O-dimethyl-s-(benzaziminomethyl) dithiophosphate | Phosphorodithioic acid | O,O-dimethyl S-((4-oxo-1,2,3-benzotriazin-3(4H)-yl)methyl) ester | Zinphos methyl
Halosulfuron-methyli5
A 841101 | Battalion | C.i. Natural Brown 3 | Halosulfuron-methyl | BSI | Inpool | Manage | MON 12000 | MON 12037 | NC 319 | Permit | Permit 75WG | Sandea | Sempra
haloxyfop-P-methyl41
Hexaconazolei42
2,4-Hexadienoic acid, potassium salt16
hexaflumuron4
Hexakis(2-methyl-2-phenylpropyl)distannoxane+i64
1,1,1,3,3,3-Hexakis(2-methyl-2-phenylpropyl)-Distannoxane | 2-(Methyl-2-phenylpropyl)distannoxane | Bendex | Bis(trineophyltin) oxide | Bis(tris(2-methyl-2-phenylpropyl)tin) oxide | Bis(tris(2-methyl-2-phenylpropyl)tin)oxide | Bis(tris(beta,beta-dimethylphenethyl)tin)oxide | Bis[tris(2-methyl-2-phenylpropyl)tin] oxide | Bis[tris(2-methyl-2-phenylpropyl)tin]oxide | Bis[tris-(2-methyl-2-phenylpropyl)tin] oxide | Di(tri-(2,2-dimethyl-2-phenylethyl)tin)oxide | Fenbutatin oxide | Fenbutatin oxide | BSI | Fenbutatin-oxide | Fenbutatin-oxyde | Fenylbutatin oxide | Fenylbutylstannium oxide | Hexakis | Hexakis (2-methyl-2-phenylpropyl)-distannoxane | Hexakis(2-methyl-2-phenylpropyl)-Distannoxane | Hexakis(beta,beta-dimethylphenethyl)-Distannoxane | Hexakis(beta,beta-dimethylphenethyl)distannoxane | Hexaneophyldistannoxane | Neostanox | Osdaran | Torque | Vendex
Hexazinonei52
3-Cyclohexy-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione | 3-Cyclohexyl-1-methyl-6-(dimethylamino)-s-trazine-2,4(1H,3H)-dione | 3-Cyclohexyl-6-(dimethylamino)-1-methyl-1,3,5-triazine-2,4(1H,3H)-dione | 3-Cyclohexyl-6-dimethylamino-1-methyl-1,2,3,4-tetrahydro-1,3,5-triazine-2,4-dione | Brushkiller | Gridball | Hexazinon | Velpar
Hexythiazoxi73
(4RS,5RS)-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-1,3-thiazolidine-3-carboxamide | (4R,5R)-rel-5-(4-chlorophenyl)-N-cyclohexyl-4-methyl-2-oxo-3-thiazolidinecarboxamide
hydramethylnon74
Icaridini7
1-(1-Methylpropoxycarbonyl)-2-(2-hydroxyethyl)piperidine | 1-Methylpropyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate | 1-Methylpropyl 2-(2-hydroxyethyl)piperidine-1-carboxylate | Bayrepel | Cutter Advanced | Methylpropyl 2-(2-hydroxyethyl)piperidinecarboxylate | Picaridin | Propidine | sec-Butyl 2-(2-hydroxyethyl)-1-piperidinecarboxylate
ICHTHAMMOL42
imazalil sulfate52
Imazamoxi51
2-(4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl)-5-(methoxymethyl)-3-pyridinecarboxylic acid | 2-(4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methoxymethylnicotinic Acid | 2-(4-Isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-(methoxymethyl)nicotinic acid | 2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-(methoxymethyl)-3-pyridinecarboxylic Acid | 5-(Methoxymethyl)-2-[4-methyl-4-(1-methylethyl)-5-oxo-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | 5-(Methoxymethyl)-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | 5-Methoxymethyl-2-(4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)nicotinic acid | Annex | Imazamox | Pulsar: Raptor
Imazapici3
2-(4-Isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl)-5-methylnicotinic acid | 2-(4-Isopropyl-4-methyl-5-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-methylnicotinic acid | 2-(5-Isopropyl-5-methyl-4-oxo-4,5-dihydro-1H-imidazol-2-yl)-5-methylnicotinic acid | 2-[4,5-Dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-5-methyl-3-pyridinecarboxylic acid | 5-Methyl-2-(4-methyl-5-oxidanylidene-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid | 5-Methyl-2-[4-methyl-4-(methylethyl)-5-oxo(2-imidazolin-2-yl)]pyridine-3-carboxylic acid | 5-Methyl-2-[4-methyl-5-oxo-4-(propan-2-yl)-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | 5-Methyl-2-[5-methyl-5-(1-methylethyl)-4-oxo-4,5-dihydro-1H-imidazol-2-yl]pyridine-3-carboxylic acid | Cadre | Imazameth | Imazapic | Imazmethyapyr
Imazapyri52
2-(4-methyl-5-oxo-4-propan-2-yl-1H-imidazol-2-yl)pyridine-3-carboxylic acid | 2-[(RS)-4-isopropyl-4-methyl-5-oxo-2-imidazolin-2-yl]nicotinic acid | 2-[4,5-dihydro-4-methyl-4-(1-methylethyl)-5-oxo-1H-imidazol-2-yl]-3-pyridinecarboxylic acid
imazethapyr4
Imidacloprid+i63
(e)-Imidacloprid | (z)-Imidacloprid | 1-((6-Chloro-3-pyridyl)methyl)-N-nitro-2-imidazolidinimine | 1-(2-Chloro-5-pyridylmethyl)-2-(nitroimino)imidazolidine | 1-[(6-Chloro-3-pyridinyl)methyl]-4,5-dihydro-N-nitro-1H-imidazol-2-amine | Admire | Advantage | Confidor | Confidor 200 SL | Confidor SL | Gaucho | Imazethapyr | Imidacloprid (old RN) | Merit | Premise 75 | Provado
2-Imidazolidinimine, 1-[(6-chloro-3-pyridinyl)methyl]-N-nitro-, (2E)-11
Indoxacarb+i93
Avaunt | Steward
Iodosulfuron-methyl-sodiumi51
Iodosulfuron-methyl sodium salt
ioxynil55
ioxynil octanoate44
ipconazole6
Iprodionei64
'rovral' HN | 1-Isopropyl carbamoyl-3-(3,5-dichlorophenyl)-hydantoin | 1-Isopropylcarbamoyl-3-(3,5-dichlorophenyl)hydantoin | 3-(3,5-Dichlorophenyl)-1-(1-methylethyl)carbamoylhydantion | 3-(3,5-Dichlorophenyl)-1-(1-methylethyl)carbamoylhydantoin | 3-(3,5-Dichlorophenyl)-N-(1-methylethyl)-2,4-dioxo-1-imidazolidinecarboxamide | 9CI | Anfor | Cda roval | Glycophen | Glycophen anphor | Glycophene | Ipcdph | Iprodial | Iprodine | Kidan | Promidione | Roval dust | Roval flo | Roval green | Roval WP | Rovral | Rovral 50WP | Rovral flo | Rovral PM | Rovrol | Turbair roval | Verisan
iron trichloridei8
Isoeugenoli10
(E)-2-methoxy-4- (1-propenyl)-Phenol | (E)-2-methoxy-4-(1-propenyl)-Phenol | (E)-2-Methoxy-4-(prop-1-enyl)phenol | (E)-2-methoxy-4-propenyl-Phenol | (e)-isoeugenol | 1-(3-Methoxy-4-hydroxyphenyl)-1-propane | 1-Hydroxy-2-methoxy-4-propen-1-ylbenzene | 2-Methoxy-4-(1-propenyl)-Phenol | 2-Methoxy-4-(1-propenyl)phenol | 2-Methoxy-4-propenyl-Phenol | 2-Methoxy-4-propenylphenol | 2-Methoxy-4-[(1E)-1-propenyl]phenol | 2-Methoxy-4-[(1E)-prop-1-en-1-yl]phenol | 3-Methoxy-4-hydroxy-1-propen-1-ylbenzene | 3-Methoxy-4-hydroxypropenylbenzene | 4-Hydroxy-3-methoxy-1-propen-1-ylbenzene | 4-Hydroxy-3-methoxy-1-propenylbenzene | 4-Hydroxy-3-methoxypropenylbenzene | Isoeugenol (I) | Isoeugenol trans-form | Propenylgualacol | trans-2-Methoxy-4-propenylphenol | trans-4-Propenylgualacol | Trans-isoeugenol | Trans-p-propenylquaiacol
isopropyl (2E,4E)-11-methoxy-3,7,11-trimethyldodeca-2,4-dienoate4
Isoxabeni72
2,6-Dimethoxy-N-(3-(1-ethyl-1-methylpropyl)-5-isoxazolyl)benzamide | N-(3-(1-Ethyl-1-methylpropyl)-5-isoxazolyl)-2,6-dimethoxybenzamide
Isoxaflutolei54
(5-Cyclopropyl-1,2-oxazol-4-yl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone | (5-Cyclopropyl-4-isoxazolyl)(2-(methylsulfonyl)-4-(trifluoromethyl)phenyl)methanone | (5-Cyclopropyl-4-isoxazolyl)[2-(methylsulfonyl)-4-(trifluoromethyl)phenyl]methanone | 4-(2-Methanesulphonyl-4-trifluoromethylbenzoyl)-5-cyclopropyl Isoxazole | 5-Cyclopropyl-4-[2-(methylsulfonyl)-4-(trifluoromethyl)benzoyl]isoxazole | Annex | Merlin
ivermectin62
B1a, B1b
Kresoxim-methyl64
Lead acetate+i47
Acetic acid lead(2+) salt | Dibasic lead acetate | Lead acetate (acn) | Lead acetate (anhydrous) | Lead acetate (Pb(Ac)2) | Lead acetate (Pb(O2C2H3)2) | Lead acetate (Pb(OAc)2) | Lead acetate | hydrate | Lead acetic acid | Lead di(acetate) | Lead diacetate | Lead dibasic acetate | Lead(2+) acetate | Lead(2+) diacetate | Lead(II) acetate | Neutral lead acetate | Normal lead acetate | Plumbous acetate | Salt of saturn | Sugar of lead
Linuroni68
3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea | N'-(3,4-dichlorophenyl)-N-methoxy-N-methylurea
lufenuron52
Magnesium phosphidei72
Maleic hydrazidei51
1,2,3,6-Tetrahydro-3,6-dioxopyridazine | 1,2-Dihydro-3,6-pyridazinedione | 1,2-dihydropyridazine-3,6-dione | 3,6-Dihydroxypyridazine | 3,6-Pyridazinediol | Antergon | Antyrost | Burtolin | cis-Butenedioic acid hydrazide | De-cut | De-sprout | Drexel-super P | Fair plus | Fazor | Gotax | Maintain 3 | Malein 30 | Malepin | Malzid | Mazide | Milurit | N,N-Maleoylhydrazine | Regulox | Retard | Sorbatran | Sprout-stop | Sucker-stuff | Super-de-sprout | Unriprim | Vondrax
Mancozebi62
((1,2-Ethanediylbis(carbamodithioato))(2-)) manganese zinc salt | Acarie M | Agrox 16D | Blecar MN | Carmazine | Crittox MZ | Dithane | Dithane 945 | Fore | Karamate | Kascade | Mancofol | Mancomix | Mancozin | Maneb-zinc | Manoseb | Manzin 80 | Marzidan | Marzin | Policar | Tritogol MZ | Zimanat | Zimaneb
Mancozeb 264
mandipropamid5
MARBOFLOXACIN3
MCPA-sodium3
Mebendazole43
mecoprop62
MCPP
Medroxyprogesterone Acetate+i46
(6alpha)-17-(Acetyloxy)-6-methylpreg-4-ene-3,20-dione | 17-Acetoxy-6alpha-methylprogesterone | 17-Acetoxy-6α-methylprogesterone | 17alpha-Hydroxy-6alpha-methylprogesterone acetate | 17α-hydroxy-6α-methylprogesterone acetate | 6-alpha-Methyl-17-alpha-acetoxyprogesterone | 6-alpha-Methyl-17-alpha-hydroxyprogesterone acetate | 6alpha-Methyl-17-acetoxy progesterone | 6alpha-Methyl-17alpha-hydroxyprogesterone acetate | 6alpha-Methyl-4-pregnene-3,20-dion-17alpha-ol acetate | 6α-Methyl-17-acetoxy progesterone | 6α-Methyl-17α-hydroxyprogesterone acetate | Depo-provera | Depo-subq provera 104 | Makena | Medroxyacetate progesterone | Medroxyprogesterone 17-acetate | Medroxyprogesterone acetate | Medroxyprogesterone acetic acid | Methylacetoxyprogesterone | Metigestrona | MPA | Provera
mefenpyr-diethyl5
Megestrol acetate44
Mepiquat chloridei51
1,1-Dimethylpiperidinium chloride | Mepiquatchloride | N,N-Dimethylpiperdinium chloride
Mesosulfuron-methyli4
Methyl 2-({[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]amino}sulfonyl)-4-{[(methylsulfonyl)amino]methyl}benzoate | Methyl 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfonyl)amino]methyl]benzoate | Methyl 2-{[(4,6-dimethoxy-2-pyrimidinyl)carbamoyl]sulfamoyl}-4-{[(methylsulfonyl)amino]methyl}benzoate | Methyl 2-{[(4,6-dimethoxypyrimidin-2-yl)carbamoyl]sulfamoyl}-4-{[(methylsulfonyl)amino]methyl}benzoate
(±)-Metalaxyl+i63
(+-)-Metalaxyl | (r)-Metalaxyl | (±)-metalaxyl | Allegiance | Apron | Apron 2E | Apron FL | Apron SD 35 | Caswell No. 375AA | D,L-N-(2,6-Dimethylphenyl)-N-(2'-methoxyacetyl)alaninate de methyle | Mefenoxam | Metalasyl | Metalaxil | Metalaxyl | Metanaxin | Metasyl | Metaxanin | Methyl 2-[(methoxyacetyl)-2,6-dimethylanilino]propanoate | Methyl N-(2,6-dimethylphenyl)-N-(methoxyacetyl)-DL-alaninate | Methyl N-(2-methoxyacetyl)-N-(2,6-xylyl)-DL-alaninate | N-(2,6-Dimethylphenyl)-N-(methoxyacetyl)-alanine methyl ester | rac-Metalaxyl | Ridomil 2E | Ridomil 72WP | Ridomil vino | Subdue 2E | Subdue 5SP
metalaxyl-M6
Metaldehyde+i72
2,4,6,8-Tetramethyl-1,3,5,7-tetraoxacyclooctane | 2,4,6,8-Tetramethyl-1,3,5,7-tetroxocane | Acetaldehyde tetramer | Agrimort | Ariotox | Cekumeta | Corry's slug death | Halizan | Helarion | Lumacrusk5 | Metacetaldehyde | Metaldehyd | Metaldeide | Puzomor | r-2,c-4,c-6,c-8-Tetramethyl-1,3,5,7-tetroxocane | Slug-tox | Snail-kil | Suprasnail
Metenaminei86
Hexamethylenetetramine1,3,5,7-Tetraazaadamantane | 1,3,5,7-Tetraazatricyclo (3.3.1.1(3,7))decane | 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane | 1,3,5,7-Tetraazatricyclo(3.3.1.13,7)decane hydroiodide | 1,3,5,7-Tetraazatricyclo(3.3.1.137)decane | 1,3,5,7-Tetraazatricyclo[3.3.1.1(3,7)]decane | 1,3,5,7-Tetraazatricyclo[3.3.1.13,7 ]decane | 1,3,5,7-Tetraazatricyclo[3.3.1.1~3,7~]decane | Aceto HMT | Aminoform | Aminoformaldehyde | Ammoform | Ammonioformaldehyde | Antihydral | Carin | Cystamin | Cystogen | Duirexol | E239 | Ekagom h | Esametilentetramina | Formaldehyde-ammonia 6:4 | Formamine | Formin | Formin (heterocycle) | Formin (the heterocyclic compound) | Grasselerator 102 | H.m.t. | Herax UTS | Heterin | HEX | Hexa | Hexa (vulcanization accelerator) | Hexa-flo-pulver | Hexaform | Hexaloids | Hexamethylamine | Hexamethylenamine | Hexamethylene tetramine | Hexamethyleneamine | Hexamethylenetetraamine | Hexamethylenetetramine | Hexamethylenetetramine (aliphatic) | Hexamethylenetetramine | 8CI | Hexamethylenetetramine | acs | Hexamethylenetetramine-palladium chloride adduct | Hexamethylenetetraminum | Hexamethylentetramin | Hexamethylentetramine | Hexamethylentetraminum | Hexamine | Hexamine (heterocycle) | Hexamine silver | Hexaminum | Hexasan | Hexilmethylenamine | HMT | HMTA | Mandelamine | Metenamina | Methamin | Methenamin | Methenamine | Methenamine silver | Methenaminum | Metramine | Naphthamine | Natasol fast orange GR salt | Nocceler H | Preparation af | Resotropin | S 4 (Heterocycle) | Sanceler h | Silver methenamine | Tetraazaadamantane | Uramin | Uratrine | Urisol | Uritone | Uro-phosphate | Urodeine | Urotropin | Urotropine | Vesaloin | Vesalvine | Vulkacit H 30 | Vulkacit H30 | Xametrin | [16]-Adamazane | INN
methabenzthiazuron41
methibenzuron
Metham-sodium1
Metham-sodium
Methidathion+i66
Phosphorodithioic acid | S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester | S-(2,3-dihydro-5-Methoxy-2-oxo-1,3,4-thiadiazol-3-methyl) dimethyl phosphorothiolothionate | S-[(5-Methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl dithiophosphate | Supracide
Methiocarb+i75
3,5-Dimethyl-4-(methylsulfanyl)phenyl methylcarbamate | 3,5-Dimethyl-4-(methylthio)phenol methylcarbamate | 3,5-Dimethyl-4-(Methylthio)phenyl methylcarbamate | 3,5-Dimethyl-4-methyl-thiophenyl-N-carbamat | 3,5-Dimethyl-4-methylmercaptophenyl-N-methyl-carbamate | 3,5-Dimethyl-4-methylthiophenyl N-methylcarbamate | 3,5-Xylenol | 4-(methylthio)- | methylcarbamate | 4-(Methylthio)-3,5-dimethylphenyl methylcarbamate | 4-(Methylthio)-3,5-xylyl methylcarbamate | 4-Methylmercapto-3,5-dimethylphenyl N-methylcarbamate | 4-Methylmercapto-3,5-xylyl methylcarbamate | 4-Methylthio-3,5-dimethylphenyl methylcarbamate | 4-Methylthio-3,5-xylyl methylcarbamate | Borderland black | Carbamic acid | methyl- | 4-(methylthio)-3,5-xylyl ester | Carbamic acid | N-methyl- | 4-(methylthio)-3,5-xylyl ester | Caswell No. 578B | Certan | CLUB | Draza | Esurol | Grandslam | Lizetan | Mercaptodimethur | Mesurol | Mesurol phenol | Methiocarbe | Methyl carbamic acid 4-(methylthio)-3,5-xylyl ester | Metmercapturan | Metmercapturon | Phenol | 3,5-dimethyl-4-(methylthio)- | methylcarbamate | Phenol | 3,5-dimethyl-4-(methylthio)- | methylcarbamate (9CI) | Phenyl-3,5-dimethyl-4-(methylthio)- | methylcarbamate
Methomyl+i75
1-(Methylthio)acetaldehyde O-methylcarbamoyloxime | 1-(Methylthio)ethylideneamino methylcarbamate | 2-Methylthio-acetaldehyd-O-(methylcarbamoyl)-oxim | 2-Methylthio-acetaldehyd-O-(methylcarbamoyl)-oxime | 2-Methylthio-propionaldehyd-O-(methylcarbamoyl)-oxim | 3-Thiabutan-2-one | O-(methylcarbamoyl)oxime | Acetimidothioic acid | methyl- | N-(methylcarbamoyl) ester | Du Pont 1179 | Du Pont Insecticide 1179 | Dupont 1179 | Flytek | Insecticide 1,179 | Insecticide 1179 | Kipsin | Lannabait | Lannate | Lannate 20 | Lannate L | Lannate LB | Lannate LV | Lannate(R) | Lanox | Lanox 216 | LANOX 90 | Memilene | Mesomile | Methavin | Methomex | Methomyl (lannate) | Methomyl 5G | Methomyl lannate | Methyl (1E)-N-([(methylamino)carbonyl]oxy)ethanimidothioate | Methyl N-(((methylamino)carbonyl)oxy)ethanimidothioate | Methyl N-((methylcarbamoyl)oxy)thioacetimidate | Methyl N-(methylcarbamoyloxy)ethanimidothioate | Methyl N-[(methylcarbamoyl)oxy]thioacetimidate | Methyl N-[[(methylamino)carbonyl]oxy]ethanimidothioate | 9CI | Methyl O-(methylcarbamoyl)thiolacethohydroxamate | Methyl O-(methylcarbamoyl)thiolacetohydroxamate | Methyl O-(methylcarbamyl)thiolacetohydroxamate | Metomil | N-((Methylcarbamoyl)oxy)thioacetimidic acid methyl ester | N-[(Methylcarbamoyl)oxy]thioacetimidic acid methyl ester | N-[[(Methylamino)carbonyl]oxy]-2-(methylthio)ethanimine | Nu-bait II | Nudrin | S-Methyl N-(methylcarbamoyloxy)thioacetimidate | S-Methyl N-[[(methylamino)carbonyl]oxy]ethanimidothioate | Sorex golden FLY bait | Thiobutan-2-one | O-(methylcarbamoyl)oxime
Methoxyfenozidei61
3-Methoxy-2-methylbenzoic acid 2-(3,5-dimethylbenzoyl)-2-(1,1-dimethylethyl)hydrazide | N'-(tert-butyl)-n'-(3,5-dimethylbenzoyl)-3-methoxy-2-methylbenzohydrazide | N-Tert-butyl-n'-(3-methoxy-O-toluoyl)-3,5-xylohydrazide
2-Methyl-4-chlorophenoxyacetic acid+i63
((4-chloro-O-Tolyl)oxy)acetic acid | (2-Methyl-4-chlorophenoxy)acetic acid | (4-chloro-2-Methylphenoxy)acetic acid | (4-chloro-O-Cresoxy)acetic acid | (4-chloro-O-Toloxy)acetic acid | 2,4-MCPA | 2-(4-chloro-2-Methylphenoxy)acetic acid | 2-Methyl-4-chlorophenoxyacetate | 2-Methyl-4-chlorophenoxymethylacetic acid | 2-Methyl-4-chlorphenoxyessigsaeure | 4-chloro-2-Methylphenoxyacetic acid | 4-chloro-O-Cresoxyacetic acid | 4-chloro-O-Toloxyacetic acid | 4-chloro-O-Tolyloxyacetic acid | Acetic acid | {[(4-chloro-O-tolyl)oxy]-} | Acme mcpa amine 4 | Agrichem MCPA-25 | 50 | Agricorn 500 | Agritox | Agritox 50 | Agroxon | Agroxone | Agroxone 50 | Albar-m | Anicon kombi | Anicon m | Atlas mcpa | B-selektonon m | Banvel m | BH mcpa | BH MCPA 75 | Bordermaster | Brominal m and plus | Campbell's MCPA 25 | 50 | Caswell No. 557C | Cekherbex | Chafer MCPA 675 | Chiptox | chloro-(O-Cresoxy)acetic acid | chloro-(O-Tolyloxy)acetic acid | Chwastox | Chwastox 30 | Chwastox extra | Chwastox f | CMP acetate | Cornox-m | Ded-weed | Dicopur-m | Dicotex | Dikotes | Dikotex | Dow MCP amine weed killer | Emcepan | Empal | Farmon MCPA 50 | FBC mcpa | FLUID 4 | Hedapur M 52 | Hedarex m | Hedonal | Hedonal m | Herbicide m | Hormotuho | Hornotuho | Kilsem | Kilsem4k-2m | Krezone | Legumex DB | Leuna m | Leyspray | Linormone | MCP | MCP ester | MCPA | Mcpa | Mcpa ester | Mcpa solution | Mecpa | Mephanac | Metaxon | Methoxone | Methyl chlorophenoxy acetic acid | Methylchlorophenoxyacetic acid | MSS MCPA 50 | Netazol | Okultin m | Phenoxylene 50 | Phenoxylene plus | Phenoxylene super | Power mcpa | Raphone | Razol dock killer | Rhomenc | Rhomene | Rhonox | Selektonon m | Seppic MMD | Shamrox | Soviet technical herbicide 2M-4C | Star mcpa | Trasan | U 46 M-FLUID | Ustinex | Vacate | Verdone | Vesakontuho mcpa | Weed-rhap | Weedar | Weedar mcpa | Weedar mcpa concentrate | Weedone | Weedone mcpa ester | WLN: QV1OR DG B1 | Zelan | [(4-Chloro-O-tolyl)oxy]acetic acid | {[(4-chloro-O-tolyl)oxy]acetic} acid
methyl octadecenoate5
methyl octadecenoate, methyl (Z)-9-octadecenoate
METHYL PALMITATE5
1-methylcyclopropene4
1-MCP, MCP
Methylene thiocyanate+i67
Amerstat 282 | Antiblu 3737 | Busan 110 | Cytox | Dithiocyanatomethane | Methylendirhodanid | Methylendithiokyanat | Methylene bis(thiocyanate) | Methylene dithiocyanate | Methylene ester OF thiocyanic acid | Methylene thiocyanic acid | Methylenebis(thiocyanate) | Methylenebisthiocyanate | Methylenedirhodanid | Methylenedirhodanide | N-948 Biocide | Nalfloc N 206 | Proxel MB | Slimicide MC | Tolcide MBT
Methyleugenoli71
1 | 2-Dimethoxy-4-(2-propenyl)benzene | 1,2-Dimethoxy-4-(2-propenyl)benzene | 1-(3 | 4-Dimethoxyphenyl)-2-propene | 4-Allyl-1 | 2-dimethoxybenzene | 4-Allyl-1,2-dimethoxy-Benzene | 4-Allyl-1,2-dimethyoxybenzene | 4-Allylveratrole | Allyl-1,2-dimethoxybenzene | Benzene | 4-(2-propenyl)-1,2-dimethoxy | Eugenol methyl | FEMA 2475
methylneodecanamide4
Metiram63
metofluthrin4
Metolachlor+i43
Bicep | Bicep 6L | Caswell No. 188DD | Codal | DUAL | Dual 25G | Dual 720EC | Dual 8E | Dual 960 EC | Dual II | Dual magnum | Dual triple | Humextra | Metelilachlor | Metetilachlor | Metolachlor (pesticide/fertilizer mixture) | Metolachlor technical | Metolachlor | herbicide (C15-H22-N-O2-Cl) | Metolaclor | Ontrack 8E | Pace 6L | Pennant | Primagram | Primextra | Turbo | Yibingjiacaoan
metosulam5
metrafenone6
Metribuzini61
3-Methylthio-4-amino-6-tert-butyl-1,2,4-triazin-5-one | 4-Amino-6-(1,1-dimethylethyl)-3-(methylthio)-1,2,4-triazin-5(4H)-one | 4-Amino-6-(2-methyl-2-propanyl)-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one | 4-Amino-6-tert-butyl-3-(methylsulfanyl)-1,2,4-triazin-5(4H)-one | 4-Amino-6-tert-butyl-3-(methylthio)-1,2,4-triazin-5-one | 4-Amino-6-tert-butyl-3-(methylthio)-as-triazin-5(4H)-one | 4-Amino-6-tert-butyl-3-methylsulfanyl-4H-[1,2,4]triazin-5-one | 4-Amino-6-tert-butyl-3-methylthio-1,2,4-triazin-5(4H)-one | 4-Amino-6-tert-butyl-3-methylthio-as-triazin-5-one | 4-Amino-6-tert-butyl-4,5-dihydro-3-methylthio-1,2,4-triazin-5-one | Sencor | Sencoral | Sencorer | Sencorex L.F. | Sengoral
Metronidazole+i56
1-(2-hydroxy-1-ethyl)-2-methyl-5-nitroimidazole | 1-(2-hydroxyethyl)-2-methyl-5-nitroimidazole | 1-(beta-Ethylol)-2-methyl-5-nitro-3-azapyrrole | 1-(beta-Hydroxyethyl)-2-methyl-5-nitroimidazole | 1-(beta-Oxyethyl)-2-methyl-5-nitroimidazole | 1-(β-ethylol)-2-methyl-5-nitro-3-azapyrrole | 1-(β-hydroxyethyl)-2-methyl-5-nitroimidazole | 1-(β-oxyethyl)-2-methyl-5-nitroimidazole | 2-methyl-1-(2-hydroxyethyl)-5-nitroimidazole | 2-methyl-3-(2-hydroxyethyl)-4-nitroimidazole | 2-methyl-5-nitroimidazole-1-ethanol | Acromona | Anabact | Arilin | Clont | Deflamon | Efloran | Elyzol | Entizol | Flagyl | Fossyol | Klion | Klont | Methronidazole | MetroCream | Metrogel | Metrogel-Vaginal | MetroLotion | Metrolyl | Metronidazol | Metronidazole Benzoate | Metronidazole in Plastic Container | Metronidazolo | Metronidazolum | Metrotop | Nalox | Nidagel | Noritate | Novonidazol | Orvagil | Protostat | Rosadan | Takimetol | Trichazole | Trichex | Trichopol | Tricowas B | Trikacide | Trikozol | Vagilen | Vagimid | Vandazole | Vertisal | Zadstat
Metsulfuron-methyli51
Metsulfuron methyl | Metsulfuron methyl ester
Mevinphos+i55
(cis-2-Methoxycarbonyl-1-methylvinyl) dimethyl phosphate | 1-Methoxycarbonyl-1-propen-2-yl-Dimethyl Phosphate | 2-Carbomethoxy-1-methylvinyl dimethyl phosphate | 2-Carbomethoxy-1-propen-2-yl dimethyl phosphate | 2-Methoxycarbonyl-1-methylvinyl dimethyl phosphate | 3-((Dimethoxyphosphinyl)oxy)-2-butenoic acid methyl ester | 3-Hydroxycrotonic acid methyl ester dimethyl phosphate | Apavinphos | cis-Mevinphos | cis-Phosdrin | Dimethyl (1-methoxycarboxypropen-2-yl)phosphate | Dimethyl (2-methoxycarbonyl-1-methylvinyl) phosphate | Dimethyl 2-methoxycarbonyl-1-methylvinyl phosphate | Dimethyl methoxycarbonylpropenyl phosphate | Duraphos | Fosdrin | Gesfid | Gestid | Meniphos | Menite | Methyl (2E)-3-[(dimethoxyphosphoryl)oxy]-2-butenoate | Methyl (2E)-3-[(dimethoxyphosphoryl)oxy]but-2-enoate | Methyl 3-(dimethoxyphosphinoyloxy)but-2-enoate | Methyl 3-[(dimethoxyphosphoryl)oxy]but-2-enoate | Mevinfos | Mevinox | Mevinphos | O | O-Dimethyl-O-(2-carbomethoxy-1-methylvinyl) phosphate | O | O-Dimethyl-O-2-carbomethoxy-1-methylvinyl phosphate | O,O-Dimethyl 1-carbomethoxy-1-propen-2-yl phosphate
MGKi11
N-Octylbicycloheptene dicarboximide
milbemectin61
-A3, -A4
milbemycin oxime4
Molinate+i47
1H-Azepine-1-carbothioic acid | hexahydro- | S-ethyl ester | C9H17NOS | Caswell No. 444 | Ethyl 1-hexamethyleneiminecarbothiolate | Felan | hexahydro-1H-Azepine-1-carbothioic acid S-ethyl ester | Higalnate | Hydram | Ialan | Jalan | Malerbane giavoni l | Molinate estrella | Molinic acid | Molmate | Ordram | Perhydroazepin-1-carbothioate | S-Ethyl 1-azepanecarbothioate | S-ethyl 1-hexamethylenaminothiocarbamate | S-Ethyl 1-hexamethyleneiminothiocarbamate | S-Ethyl azepane-1-carbothioate | S-ethyl hexahydro-1H-azepine-1- carbothioate | S-Ethyl hexahydro-1H-azepine-1-carbothioate | S-Ethyl Hexahydroazepine-1-carbothioate | S-Ethyl perhydroazepin-1-carbothioate | S-Ethyl perhydroazepine-1-thiocarboxylate | S-ethyl-n,n-hexamethylenethiocarbamate | S-ethyl-n-hexamethylenethiocarbamate | Sakkimol | Stauffer R-4,572 | Yalan | Yulan
MUSTARD POWDER3
Myclobutanil+i74
(+-)-Myclobutanil | 2-P-Chlorophenyl-2-(1H-1,2,4-triazol-1-ylmethyl)hexanenitrile | alpha-Butyl-alpha-(4-chlorophenyl)-1H-1,2,4-triazole-1-propanenitrile
N-DODECYLGUANIDINE ACETATE72
guanidine, cytrex, doguadine
naftalofos3
naphthalophos
Naled+i64
(±)-naled | 1,2-Dibromo-2,2-Dichloroethyl dimethyl phosphate | 1,2-Dibromo-2,2-dichloroethyl dimethyl phosphatic acid | Alvora | Arthodibrom | Bromchlophos | Bromex | Bromex 50 | BRP | Dibrom | Dibromfos | Dimethyl 1,2-dibromo-2,2-dichloroethyl phosphate | dimethyl-1,2-dibromo-2,2-dichloroethyl phosphate | Flibol ex | Fosbrom | Hibrom | Naled | Nikabrom | O,O-dimethyl O-2,2-dichloro-1,2-dibromoethyl phosphate | O,O-Dimethyl-O-(1,2-dibromo-2,2-dichloroethyl)phosphate | O-(1,2-Dibromo-2,2-dichloroethyl)-O,O-dimethyl phosphate | o-Dibrom 8E | Ortho Dibrom 8E | Ortho-dibrom | Orthodibromo | Phosphoric acid | 1,2-dibromo-2,2-dichloroethyl dimethyl ester
Napropamidei5
Devrinol | N,N-Diethyl-2-(1-naphthalenyloxy)propanamide | N,N-Diethyl-2-(1-naphthalenyloxy)propionamide | N,N-Diethyl-2-(1-Naphthyloxy)propanamde | N,N-Diethyl-2-(1-naphthyloxy)propanamide | N,N-Diethyl-2-(1-naphthyloxy)propionamide | N,N-Diethyl-2-naphthyloxypropanamide | Waylay
naptalam1
NEEM SEED EXTRACT POWDER3
NICARBAZIN5
nitenpyram41
nitrothal-isopropyl3
Norflurazoni4
4-chloro-5-(Methylamino)-2-(alpha,alpha,alpha-trifluoro-m-tolyl)-3(2H)-pyridazinone | 4-chloro-5-(Methylamino)-2-[3-(trifluoromethyl)phenyl]-3(2H)-pyridazinone | SAN 9789 | Solicam | Zorial
Novaluroni51
(RS)-1-[3-chloro-4-(1,1,2-trifluoro-2-trifluoromethoxyethoxy)phenyl]-3-(2,6-difluorobenzoyl)urea | N-[({3-chloro-4-[1,1,2-trifluoro-2-(trifluoromethoxy)ethoxy]phenyl}amino)carbonyl]-2,6-difluorobenzamide | Novaluron | Rimon
2-octyl-2H-isothiazol-3-one63
omethoate53
Oryzalini51
ostramone3
mixture of (E)-tetradec-11-en-1-yl acetate and (Z)-tetradec-11-en-1-yl acetate
oxabetrinil3
oxadiargyl45
Oxadiazoni64
2-tert-Butyl-4-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazolin-5-one | 2-tert-Butyl-4-(2,4-dichloro-5-isopropoxyphenyl)-5-oxo-1,3,4-oxadiazoline | 2-tert-Butyl-4-(2,4-dichloro-5-isopropoxyphenyl)-D2-1,3,4-oxadiazolin-5-one | 2-tert-Butyl-4-(2,4-dichloro-5-isopropyloxyphenyl)-1,3,4-oxadiazolin-5-one | 3-(2,4-Dichloro-5-(1-methylethoxy)phenyl)-5-(1,1-dimethylethyl)-1,3,4-oxadiazol-2(3H)-one | 3-(2,4-Dichloro-5-isopropoxyphenyl)-5-(2-methyl-2-propanyl)-1,3,4-oxadiazol-2(3H)-one | 5-tert-Butyl-3-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazol-2(3H)-one | 5-tert-Butyl-3-(2,4-dichloro-5-isopropoxyphenyl)-1,3,4-oxadiazolin-2-one | 5-tert-butyl-3-[2,4-dichloro-5-(1-methylethoxy)phenyl]-1,3,4-oxadiazol-2(3H)-one | Oxadiazone | Oxydiazon | Ronstan
oxadixyl3
Oxamyl+i64
Blade | Dioxamyl | Du pont 1410 | Insecticide-nematicide 1410 | Nematicide 1410 | Oxamyl (pesticide) | Thioxamyl | Vydate | Vydate l insecticide/nematicide | Vydate l oxamyl insecticide/nematocide
Oxybenzonei253
(2-Hydroxy-4-methoxyphenyl)phenylmethanone | 2-Benzoyl-5-methoxyphenol | 2-Hydroxy-4-methoxybenzophenone | 4-Methoxy-2-hydroxybenzophenone | 4-Methoxy-2-hydroxybenzophenone butyric acid | Benzophenone-3 | Oxibenzona | Oxybenzonum
oxycarboxin41
oxydemeton-methyl11
Oxyfluorfeni6
2-Chloro-1-(3-ethoxy-4-nitrophenoxy)-4-(trifluoromethyl)benzene | 2-Chloro-1-(3-ethoxy-4-nitrophenoxy)-4-trifluoromethylbenzene | 2-Chloro-a,a,a-trifluoro-p-tolyl-3-ethoxy-4-nitrophenyl Ether | 4-[2-Chloro-4-(trifluoromethyl)phenoxy]-2-ethoxy-1-nitrobenzene | Galigan | GOAL | GOldate | Hada F | Koltar | Oxyfluoren | Oxyfluorofen | Oxyfluorofene | Oxyflurofen | Oxygold | Zoomer
Oxythioquinox (Chinomethionat)46
oxythioquinox, quinomethionate
Paclobutrazoli5
(2S,3S)-1-(4-Chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)-3-pentanol | (2S,3S)-1-(4-Chlorophenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol | (2S,3S)-1-(4-Chlorphenyl)-4,4-dimethyl-2-(1H-1,2,4-triazol-1-yl)pentan-3-ol | 1-tert-Butyl-2-(p-chlorobenzyl)-2-(1,2,4-triazol-1-yl)ethanol | Bonzi | Cultar | Friazole | Paclobutrazol | Parlay | Trimmit
Paraquat dichloride+i46
1 | 1'-Dimethyl-4,4'-bipyridynium dichloride | 1,1 -Dimethyl-4,4 -bipyridinium | 1,1'-Dimethyl-4 | 4'-dipyridylium chloride | 1,1'-Dimethyl-4,4'-bipyridinium dichloride hydrate | 1,1'-Dimethyl-4,4'-bipyridynium dichloride | 1,1'-Dimethyl-4,4'-dipyridinium-dichlorid | 1,1'-Dimethyl-4,4'-dipyridylium dichloride | 1,1'-Dimethyl-[4,4'-bipyridin]-1,1'-diium dichloride | 1,1-Dimethyl-4,4-dipyridilium dichloride | 4,4'-Bipyridinium | 1,1'-dimethyl- | dichloride | 4,4'-Dimethyldipyridyl dichloride | Bipyridinium | 1,1'-dimethyl-4,4'- | dichloride | Cekuquat | Crisquat | Dextrone X | Dextrone-x | Dexuron | Dimethyl viologen chloride | Dimethyldipyridyl chloride | Dwuchlorek 1,1'-dwumetylo-4,4'-dwupirydyniowy | Esgram | Galokson | Goldquat 276 | Gramixel | Gramoxone | Gramoxone D | Gramoxone dichloride | Gramoxone S | Gramoxone w | Gramuron | Herbaxon | Herboxone | Methyl viologen | Methyl viologen (reduced) | Methyl viologen dichloride | Methyl-Viologen | Methylviologen chloride | N,N'-Dimethyl-4 | 4'-dipyridylium dichloride | N,N'-Dimethyl-4,4'-bipyridinium dichloride | N,N'-Dimethyl-4,4'-bipyridylium dichloride | N,N'-Dimethyl-4,4'-dipyridylium dichloride | N,N'-Dimethylviologen | Ortho paraquat CL | Parakwat | Paraquat chloride | Paraquat CL | Paraquat | dichloride | Paraquat-dichloride | Pathclear | Pillarquat | Pillarxone | Toxer total
Pebulate+i43
Butylethylcarbamothioic acid S-propyl ester | Butylethylthiocarbamic acid S-propyl ester | Carbamic acid | butylethylthio- | S-propyl ester | Carbamothioic acid | butylethyl- | S-propyl ester (9ci) | Caswell No. 710 | N-propyl-n-ethyl-n-(n-butyl)thiocarbamate | N-propyl-n-ethyl-n-(n-butyl)thiolcarbamate | PEBC | Pebulat | Pebulic acid | Propyl ethylbutylthiocarbamate | Propyl ethylbutylthiolcarbamate | Propyl n-ethyl-n-butylthiocarbamate | Propyl-ethylbutylthiocarbamate | Propylethyl-n-butylthiocarbamate | S-(n-propyl)-n-ethyl-n-butylthiocarbamate | S-(n-propyl)-n-ethyl-n-n-butylthiocarbamate | S-propyl butyl(ethyl)thiocarbamate | S-propyl butylethylcarbamothioate | S-propyl butylethylthiocarbamate | S-propyl-n-aethyl-n-butyl-thiocarbamat | S-propyl-n-butyl-n-ethylthiocarbamate | Stauffer R-2061 | Tillam | Tillam-6-E
Pectini6
penconazole4
pencycuron4
Pendimethalin+i83
3,4-Dimethyl-2,6-dinitro-N-(1-ethylpropyl)aniline | Accotab | Caswell No. 454BB | Go-go-san | Herbadox | Herbodox | N-(1-ethylpropyl)-2,6-dinitro-3,4-xylidine | N-(1-Ethylpropyl)-3,4-dimethyl-2,6-dinitroaniline | N-(1-Ethylpropyl)-3,4-dimethyl-2,6-dinitrobenzenamine | N-(3-Pentyl)-3,4-dimethyl-2,6-dinitroaniline | Pay-off | Pendimethaline | Penoxalin | Penoxyn | Pentagon | Phenoxalin | Pre-M 60DG | Prowl | Prowl 3.3E | Prowl 4E | Sipaxol | Southern weed grass control | Stomp | Stomp 330D | Stomp 330E | Stomp h | SWGC | Tendimethalin | Wax up | Way up | Wayup
penflufen5
penthiopyrad5
peppermint oil10
Permethrin+i166
(3-Phenoxyphenyl)methyl (+-)-cis,trans-3-(2,2-dichloroethenyl)-2,2-dimethylcyclopropanecarboxylate | 3-(2,2-Dichloroethenyl)-2,2-dimethylcyclopropane carboxylic acid | (3-phenoxyphenyl) methyl ester | Acticin | Elimite | Lyclear | Nix
Phenmedipham+i63
3-((Methoxycarbonyl)amino)phenyl (3-methylphenyl)carbamate | 3-(Carbomethoxyamino)phenyl 3-methylcarbanilate | 3-Methoxycarbonyl-N-(3'-methylphenyl)-carbamat | 3-Methoxycarbonylaminophenyl 3'-methylcarbanilate | 3-Methoxycarbonylaminophenyl N-3'-methylphenylcarbamate | 3-[(Methoxycarbonyl)amino]phenyl (3-methylphenyl)carbamate | Alegro | Beetomax | Beetup | BETA | Betaflow | Betalion | Betamix | Betanal | Betanal e | Betanal tandem | Betosip | Caswell No. 648B | Ethofumesate-phenmedipham | Fender | Fenmedifam | Goliath | Gusto | Headland dephend | Kemifam | m-Hydroxycarbanilic acid methyl ester m-methylcarbanilate | Medipham | Methyl 3-(3-methylcarbaniloyloxy)carbanilate | Methyl 3-(m-tolylcarbamoyloxy)phenylcarbamate | Methyl m-hydroxycarbanilate m-methylcarbanilate | Methyl m-hydroxycarbanilate m-methylcarbanilate (ester) | Methyl m-hydroxycarbanilate | m-methylcarbanilate | Methyl-3-(3-methylcarbaniloyloxy) carbanilate | Methyl-3-hydroxycarbanilate-3-methylcarbanilate | Methyl-3-m-tolycarbamoloxyphenyl carbamate | Morton EP 452 | Phendipham | Phenmediphame | Pistol | Pistol 400 | Protrum k | Schering 4072 | Spin-aid | Suplex | Synbetan p | Tripart beta | Tripart beta 2 | Vangard | Vanguard
Phenolphthaleini45
3,3-Bis(4-hydroxyphenyl)-1(3H)-isobenzofuranone | 3,3-Bis(4-hydroxyphenyl)-2-benzofuran-1(3H)-one | 3,3-Bis(4-hydroxyphenyl)phthalide | 3,3-Bis(p-hydroxyphenyl)phthalide | Agoral | Alophen | Alpha-di(p-hydroxyphenyl)phthalide | Chocolax | Colax | Correctol | Dihydroxyphthalophenone | Doxan | Doxidan | Espotabs | Euchessina | Evac-q-kit | Evac-q-kwik | Evac-q-tabs | Evac-u-gen | Evac-v-lax | Ex-lax | Feen-a-mint gum | Feen-a-mint laxative mints | Femilax | Fenolftalein | Fenolftaleina | Koprol | Lax-pills | Laxcaps | Laxin | Laxogen | LILO | Medilax | Phenolax | Phenolphtaleine | Phenolphthaleinum | Phenophthalein | Phillips gelcaps | Phthalimetten | Phthalin | Prulet | Purga | Purgen | Purgophen | Spulmako-lax | Trilax
phenylmercury derivative of pyrocatechol3
Phenytoin+i46
5,5-Diphenyl-imidazolidine-2,4-dione | 5,5-Diphenylhydantoin | 5,5-diphenylimidazolidine-2,4-dione | 5,5-diphenyltetrahydro-1H-2,4-imidazoledione | 5,5-Diphenyltetrahydro-1H-2,4-imidazoledione | 5,5-Dwufenylohydantoina | Dihydantoin | DILANTIN | Dilantin-125 | Diphenylan Sodium | Diphenylhydantoin | Diphenylhydatanoin | Epanutin | Eptoin | Fenitoina | PHENTYTOIN | Phenytek | Phenytoin Sodium | Phenytoine | Phenytoinum
Phorate+i75
Aastar | Agrimet | Forate | Geomet | Granutox | O,O-diethyl ethylthiomethyl phosphorodithioate | O,O-diethyl S-(ethylthio)methyl phosphorodithioate | O,O-diethyl S-(ethylthiomethyl) phosphorodithioate | O,O-diethyl s-ethylmercaptomethyl dithiophosphate | O,O-diethyl S-ethylmercaptomethyl dithiophosphonate | O,O-diethyl S-ethylthiomethyl dithiophosphate | O,O-diethyl S-ethylthiomethyl dithiophosphonate | O,O-diethyl s-ethylthiomethyl thiothionophosphate | O,O-diethyl S-[(ethylsulfanyl)methyl] dithiophosphate | O,O-diethyl S-[(ethylsulfanyl)methyl] phosphorodithioate | O,O-diethyl S-[(ethylthio)methyl] phosphorodithioate | O,O-diethyl-S-((ethylthio)methyl)phosphorodithioate | Phoric acid | Phosphorodithioic acid | O,O-diethyl S-((ethylthio)methyl) ester | Rampart | Terrathion | Thimate | Thimenox | Thimet | Timet | Vegfru foratox | Vergfru foratox | Volphor
phosmet72
phthalophos, PMP
Piclorami41
4-Amino-3,5,6-trichloropyridine-2-carboxylic acid | 4-amino-3,5,6-trichloro-2-pyridinecarboxylic acid
picolinafen4
pinoxaden5
Piperonyl butoxidei141
(3,4-Methylenedioxy-6-propylbenzyl) (butyl) diethylene glycol ether | (Butylcarbityl)(6-propylpiperonyl)ether | 2-(2-Butoxyethoxy)ethyl 6-propylpiperonyl ether | 5-Propyl-4-(2,5,8-trioxa-dodecyl)-1,3-benzodioxole | 6-Propylpiperonyl butyl diethylene glycol ether | alpha-(2-(2-N-Butoxyethoxy)-ethoxy)-4,5-methylenedioxy-2-propyltoluene | alpha-[2-(2-Butoxyethoxy)ethoxy]-4,5-(methylenedioxy)-2-propyltoluene | Butyl carbitol 6-propylpiperonyl ether
Pirimicarb+i55
2-dimethylamino-5,6-dimethylpyrimidin-4-yldimethylcarbamate | 5,6-Dimethyl-2-dimethylamino-4-pyrimidinyldimethylcarbamate | ABOL | Aficida | Aphox | Caswell No. 359C | DEMO | Dimethylcarbamic acid 2-(dimethylamino)-5,6-dimethyl-4-pyrimidinyl ester | FBC pirimicarb 50 | Fernos | Phantom | Pirimor | Pirimor 50 DP | Pirimor g | Pirimor granulate | Power demo | Primicarbe | Pyrimicarbe | Pyrimor | Rapid | TPC-PC001 | ZZ-aphox
Pirimiphos-methyl+i53
O-[2-(Diethylamino)-6-methylpyrimidin-4-yl] O,O-dimethyl thiophosphate | Pirimifosmethyl | Pirimiphos methyl | Pirimiphosmethyl | Pyrimiphos methyl
potassium hydrogencarbonatei8
POTASSIUM SORBATEi8
Prallethrini82
(RS)-2-methyl-4-oxo-3-prop-2-ynylcyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate | 2-methyl-4-oxo-3-(2-propynyl)-2-cyclopenten-1-yl 2,2-dimethyl-3-(2-methyl-1-propenyl)cyclopropanecarboxylate
PROCAINE HYDROCHLORIDE4
Prochlorazi53
N-Propyl-N-[2-(2,4,6-trichlorophenoxy)ethyl]-1H-pyrazole-1-carboxamide
Procymidone31
Prodiaminei5
5-dipropylamino-alpha-,alpha-,alpha--trifluoro-4,6-dinitro-o-toluidine | 2,4-dinitro-N3,N3-dipropyl-6-(trifluoromethyl)-1,3-benzenediamine
Profenofos+i43
(RS)-(O-4-bromo-2-chlorophenyl O-ethyl S-propyl phosphorothioate) | Curacron | O-(4-Bromo-2-chlorophenyl) O-ethyl S-propyl thiophosphate | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate | Phosphorothioic acid | O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester
profoxydim43
clefoxydim
Prohexadione-calciumi4
3,5-Dioxo-4-propionyl-cyclohexanecarboxylic acid calcium salt | Calcium bis(3,5-dioxo-4-propanoylcyclohexanecarboxylate) | Calcium bis(3,5-dioxo-4-propionylcyclohexanecarboxylate)
Prometryni4
2-(methylthio)-4,6-Bis(isopropylamino)-S-triazine | N,N'-bis(1-methylethyl)-6-methylthio-1,3,5-triazine-2,4-diamine | N,N'-diisopropyl-6-(methylthio)-1,3,5-triazine-2,4-diamine | Prometryne
Propachlor+i44
2-Chloro-N-(1-methylethyl)-N-phenylacetamide | 2-Chloro-N-isopropyl-N-phenylacetamide | 2-Chloro-N-isopropylacetanilide | a-Chloro-n-isopropylacetanilide | Acilid | Albras propachlor | Albrass | alpha-chloro-N-Isopropylacetanilid | Alpha-chloro-n-isopropylacetanilide | Amber | Atlas orange | Bexton | Bexton 4L | Caswell No. 194 | Chloressigsaeure-N-isopropylanilid | Chloro-n-isopropylacetanilide | Croptex | Isopropyl-2-chloroacetanilide | Kartex a | N-Isopropyl-2-chloroacetanilide | N-isopropyl-a-chloroacetanilide | N-isopropyl-alpha-chloroacetanilide | N-Methylethyl-N-chloroacidobenzene | Nitacid | Niticid | Portman propachlor 50FL | Prolex | Prolexpropaclor | Propachlor and atrazine | Propachlore | Ramrod | Ramrod 65 | Ramrod flowable | Ramrod-atrazine | Satecid | Sentinel | Tripart granular | Tripart sentinel
Propamocarb hydrochloride+i42
propyl [3-(dimethylamino)propyl]carbamate hydrochloride
propanil51
DCPA
propaquizafop4
Propargitei56
2-(4-Tert-butylphenoxy)cyclohexyl prop-2-ynyl sulfite | 2-(4-Tert-butylphenoxy)cyclohexyl prop-2-ynyl sulphite | 2-(P-t-Butylphenoxy)cyclohexyl propargyl sulfite | 2-(P-Tert-butylphenoxy)cyclohexyl 2-propynyl sulfite | 2-(P-Tert-butylphenoxy)cyclohexyl propargyl sulfite | BPPS
Propazinei43
2,4-Bis(isopropylamino)-6-chloro-S-triazine | 2-Chloro-4,6-bis(isopropylamino)-1,3,5-triazine | 2-chloro-4,6-Bis(isopropylamino)-S-triazine | 6-chloro-N,N'-(1-methylethyl)-[1,3,5]triazine-2,4-diamine | 6-chloro-N,N'-bis(1-methylethyl)-1,3,5-triazine-2,4-diamine | 6-chloro-N,N'-diisopropyl-1,3,5-triazine-2,4-diamine | 6-chloro-N,N'-diisopropyl-1,3,5-triazine-2,4-diyldiamine | Prozinex
Propetamphos+i44
(e)-1-Methylethyl 3-(((ethylamino)methoxyphosphinothioyl)oxy)-2-butenoate | 1-Methylethyl (e)-3-(((ethylamino)methoxyphosphinothioyl)oxy)-2-butenoate | O-Methyl O-{1-[(propan-2-yl)oxycarbonyl]prop-1-en-2-yl} ethylamidothiophosphate
Propiconazolei63
(+-)-1-[2-(2,4-Dichlorophenyl)-4-propyl-1,3-dioxolan-2-yl-methyl]-1H-1,2,4-triazole
propineb3
Propoxur+i96
2-(1-Methylethoxy)phenol methylcarbamate | 2-(1-Methylethoxy)phenyl methyl carbamate | 2-(1-methylethoxy)phenyl methylcarbamate | 2-(1-Methylethoxy)phenyl N-methylcarbamate | 2-(propan-2-yloxy)phenyl methylcarbamate | 2-Isopropoxyphenyl methylcarbamate | 2-Isopropoxyphenyl N-methylcarbamate | 2-Isopropoxyphenyl-N-methylcarbamat | 2-Isopropoxyphenyl-N-methylcarbamate | 2-[(1-methylethyl)oxy]phenyl methylcarbamate | Aprocarb | Arporcarb | Bayer B 5122 | Baygon | Bifex | Blattanex | Blattanex 20 | Blattosep | Bolfo | Boruho | Boruho 50 | Boygon | Brifur | Brygou | Carbamic acid | methyl- | 2-(1-methylethoxy)phenyl ester | Carbamic acid | methyl- | O-isopropoxyphenyl ester | Caswell No. 508 | Chemagro 9010 | Dalf dust | Fumite propoxur | Invisi-gard | IPMC | Isocarb | Isopropoxyphenyl methylcarbamate | Mrowkozol | N-2-(1-Methylethoxy)phenyl methyl-carbamate | N-Methyl-2-isopropoxyphenylcarbamate | O isopropoxyphenylmethylcarbamate | O-(2-Isopropoxyphenyl) N-methylcarbamate | O-isopropoxyphenyl methylcarbamate | O-isopropoxyphenyl n-methylcarbamate | O-isopropoxyphenylmethylcarbamate | PHC (carbamate) | Phenol | o-isopropoxy- | methylcarbamate | Pillargon | Propogon | Propoksuru | Propotox | Propotox m | Propoxure | Propoxylor | Propyon | Rhoden | Sendran | Suncide | Tendex | Tugen | Tugon fliegenkugel | Undeen | Unden (pesticide) | Unden 50PM | Undene
Propylene glycoli905
(RS)-1,2-Propanediol | 1,2-(RS)-Propanediol | 1,2-Dihydroxypropane | 1,2-Propanediol | 1,2-Propylene glycol | 1,2-Propylenglykol | 2,3-Propanediol | 2-Hydroxypropanol | a-Propylene glycol | Aliphatic alcohol | alpha-Propylene glycol | Chilisa FE | DL-1,2-Propanediol | Dl-Propylene glycol | Dowfrost | Glycol | Ilexan P | Inhibited 1,2-propylene glycol | Isopropylene glycol | Methyl glycol | Methylethyl glycol | Methylethylene glycol | Monopropylene glycol | Prolugen | Propane-1,2-diol | Propanediol | Propylene glycol usp | Propylenglycol | Sentry Propylene Glycol | Sirlene | Solar Winter Ban | Solargard P | Trimethyl glycol | Ucar 35
PROPYLENE OXIDEi93
Propyzamide+i65
3,5-dichloro-N-(1,1-dimethyl-2-propynyl)benzamide | 3,5-dichloro-N-(1,1-dimethylprop-2-ynyl)benzamide | Pronamide | 3,5-Dichloro-N-(1,1-dimethyl-2-propynyl)benzamide
proquinazid5
prosulfocarb52
Prosulfuroni51
1-(4-Methoxy-6-methyl-1,3,5-triazin-2-yl)-3-[2-(3,3,3-trifluoropropyl)phenylsulfonyl]urea | N-[(4-Methoxy-6-methyl-1,3,5-triazin-2-yl)carbamoyl]-2-(3,3,3-trifluoropropyl)benzenesulfonamide | N-[[(4-Methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl]-2-(3,3,3-trifluoropropyl)benzenesulfonamide
prothioconazole6
prothiofos3
Pymetrozinei75
(e)-4,5-dihydro-6-Methyl-4-((3-pyridinylmethylene)amino)-1,2,4-triazin-3(2H)-one
pyraclofos3
Pyraclostrobini5
Pyraclostrobine
Pyraflufen-ethyli61
ethyl 2-chloro-5-(4-chloro-5-difluoromethoxy-1-methylpyrazol-3-yl)-4-fluorophenoxyacetate | ethyl [2-chloro-5-[4-chloro-5-(difluoromethoxy)-1-methyl-1H-pyrazol-3-yl]-4-fluorophenoxy]acetate
pyrasulfotole4
Pyridabeni73
4-chloro-2-(1,1-Dimethylethyl)-5-(((4-(1,1-dimethylethyl)phenyl)methyl)thio)-3(2H)-pyridazinone | Sanmite
pyridate52
Pyrimethanili61
2-Anilino-4,6-dimethylpyrimidine | 4,6-Dimethyl-N-phenyl-2-Pyrimidinamine | 4,6-Dimethyl-N-phenylpyrimidin-2-amine | Mythos | Pyrimethanil | BSI | Scala | SN 100309 | ZK 100309
Pyriproxyfeni122
4-Phenoxyphenyl (rs)-2-(2-pyridyloxy)propyl ether
Pyrithiobac-sodiumi4
Pyrithiobac sodium
pyroxasulfone42
pyroxsulam5
Quincloraci61
3,7-Dichloro-8-quinolinecarboxylic acid | Drive | Facet
QUININE SULFATE62
Quinoxyfeni62
5,7-dichloro-4-quinolyl 4-fluorophenyl ether | 5,7-dichloro-4-(4-fluorophenoxy)quinoline
Quizalofop-ethyli31
Ethyl 2-{3-[(6-chloro-2-quinoxalinyl)oxy]phenoxy}propanoate | Ethyl 2-{3-[(6-chloroquinoxalin-2-yl)oxy]phenoxy}propanoate | Quizaloofop
quizalofop-P-ethyl5
quizalofop-P-tefuryl55
(R)-2-(4-chloro-2-methylphenoxy)propionic acid81
Ractopamine hydrochloride1
rhodethanil3
rodéthanil
Rimsulfuroni5
1-(4,6-dimethoxypyrimidin-2-yl)-3-(3-ethylsulfonyl-2-pyridylsulfonyl)urea | N-[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]-3-(ethylsulfonyl)-2-pyridinesulfonamide
S-metolachlor62
saflufenacil5
sedaxane4
cis-, trans-
selamectin3
Sethoxydimi4
2-(N-ethoxy-C-propyl-carbonimidoyl)-5-(2-ethylsulfanylpropyl)-3-hydroxy-cyclohex-2-en-1-one | 2-(N-Ethoxybutanimidoyl)-5-[2-(ethylsulfanyl)propyl]-3-hydroxycyclohex-2-en-1-one | 2-[1-(Ethoxyimino)butyl]-5-[2-(ethylthio)propyl]-3-hydroxy-2-cyclohexen-1-one | Aljaden | Checkmate | Cyethoxydim | Expand | Fervinal | Grasidim | NaBu | Tritex-extra
siduron4
Simazinei53
2,4-Bis(ethylamino)-6-chloro-1,3,5-triazine | 2,4-Bis(ethylamino)-6-chloro-S-triazine | 2-chloro-4,6-Bis(ethylamino)-1,3,5-triazine | 2-chloro-4,6-Bis(ethylamino)-S-triazine | 6-chloro-N(2),N(4)-Diethyl-1,3,5-triazine-2,4-diamine | 6-chloro-N,N'-diethyl-[1,3,5]triazin-2,4-diamine | Gesatop | Princep | Simanex
Sodium propionatei7
spinetoram72
Spinosad114
spinosyn -A, -D
spirotetramat6
Spiroxaminei52
(8-Tert-butyl-1,4-dioxa-spiro[4.5]dec-2-ylmethyl)-ethyl-propyl-amine | 8-(1,1-Dimethylethyl)-N-ethyl-N-propyl-1,4-dioxaspiro(4.5)decane-2-methanamine | Impulse | KWG4168 | Prosper
sulfaquinoxaline4
sulfometuron-methyl4
sulfosulfuron61
sulfoxaflor5
sulfuryl fluoride64
TAR3
Tau-fluvalinate+i73
(RS)-alpha-cyano-3-phenoxybenzyl N-(2-chloro-alpha,alpha,alpha-trifluoro-P-tolyl)-D-valinate | Fluvalinate | Fluvarol | Fluwarol | Klartan | N-[2-chloro-4-(Trifluoromethyl)phenyl]-D-valine cyano(3-phenoxyphenyl)methyl ester | Tau-fluvalinic acid
tebuconazole73
Tebufenozidei72
3,5-Dimethylbenzoic acid 1-(1,1-dimethylethyl)-2-(4-ethylbenzoyl)hydrazide | N'-(t-butyl)-n'-(3,5-dimethylbenzoyl)-N-(4-ethylbenzoyl)hydrazine
Tebufenpyradi51
4-chloro-N-((4-(1,1-Dimethylethyl)phenyl)methyl)-3-ethyl-1-methyl-1H-pyrazole-5-carboxamide | N-(4-t-Butylbenzyl)-4-chloro-3-ethyl-1-methylpyrazole-5-carboxamide | Pyranica
Tebuthiuroni51
1,3-Dimethyl-1-[5-(2-methyl-2-propanyl)-1,3,4-thiadiazol-2-yl]urea | 1-(5-(tert-Butyl)-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | 1-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-1,3-dimethylurea | Brulan | Brush bullet | Bushwacker | Graslan | N-(5-(1,1-Dimethylethyl)-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea | N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)-N,N'-dimethylurea | N-[5-(1,1-Dimethylethyl)-1,3,4-thiadiazol-2-yl]-N,N'-dimethylurea | N-[5-(1,1-Dimethylethyl)-1,3,4-thiadiazol-2-yl]-NN'-dimethylurea | N-[5-(tert-butyl)(1,3,4-thiadiazol-2-yl)]-N-methyl(methylamino)carboxamide | Perflan | Perfmid | Preflan | Prefmid | Spike | Tebulan | Tiurolan
Tefluthrin+i42
Force | Forza | Tefluthrine | Tetrafluthrin
temephos51
temefos
Tepraloxydimi44
(EZ)-(RS)-2-{1-[(2E)-3-Chloroallyloxyimino]propyl}-3-hydroxy-5-perhydropyran-4-ylcyclohex-2-en-1-one | 2-(N-{[(2E)-3-chloroprop-2-en-1-yl]oxy}propanimidoyl)-3-hydroxy-5-(tetrahydro-2H-pyran-4-yl)cyclohex-2-en-1-one | 2-[(1E)-N-{[(2E)-3-Chloro-2-propen-1-yl]oxy}propanimidoyl]-3-hydroxy-5-(tetrahydro-2H-pyran-4-yl)-2-cyclohexen-1-one | 2-[(1E)-N-{[(2E)-3-Chloroprop-2-en-1-yl]oxy}propanimidoyl]-3-hydroxy-5-(tetrahydro-2H-pyran-4-yl)cyclohex-2-en-1-one | trans-2-[1-(3-Chloroallyloxyimino)propyl]-3-hydroxy-5-(tetrahydro-2H-pyran-4-yl)-2-cyclohexen-1-one
Terbacili31
3-tert-butyl-5-chloro-6-methyluracil | 5-chloro-3-(1,1-dimethylethyl)-6-methyl-2,4(1H,3H)-pyrimidinedione
terbufos53
terbuthylazine6
terbutryn3
terbutryne
tetrachlorvinphos61
stirofos, CVMP
Tetraconazolei61
(RS)-2-(2,4-Dichlorophenyl)-3-(1H-1,2,4-triazol-1-yl)propyl 1,1,2,2-tetrafluoroethyl ether | 1-[2-(2,4-Dichlorophenyl)-3-(1,1,2,2-tetrafluoroethoxy)propyl]-1H-1,2,4-triazole | Eminent
Tetracycline hydrochloride (internal use)31
tetradifon3
tedion
Tetramethrin+i82
(1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemate | (1-Cyclohexene-1,2-dicarboximido)methyl chrysanthemumate | Cyclohexene-1-dicarboximidomethylchrysanthemate | Etramethrin isomer | Killgerm PY-kill w | N-(Chrysanthemoxymethyl)-1-cyclohexene-1,2-dicarboximide | Neo-pynamin | Neopinamin | Neopinamine | Neopynamin | Phthalthrin | PY-kill | Tetramethrin isomer
TETRAMETHRIN [(1R)- ISOMERS]3
Thiabendazolei94
1yvm | 2-(1,3-Thiazol-4-yl)-1H-benzimidazole | 2-(1,3-Thiazol-4-yl)benzimidazole | 2-(4'-Thiazolyl)benzimidazole | 2-(4-Thiazolyl)-1H-Benzimidazole | 2-(4-Thiazolyl)-Benzimidazole | 2-(4-Thiazolyl)benzimidazole | 2-(Thiazol-4-yl)benzimidazole | 2-Thiazol-4-yl-1H-benzoimidazole | 2-Thiazole-4-ylbenzimidazole | 2-[4-Thiazoly]benzimidazole | 4-(2-benzimidazolyl)thiazole | 5-(4-Thiazolyl)benzimidazole | Apl-luster | Arbotect | Biogard | Bioguard | Bovizole | Captan t | Chemviron TK 100 | Cropasal | Drawipas | E-z-Ex | Eprofil | Equivet TZ | Equizole | Equizole a | Helmindrax octelmin | Hokustar HP | Hymush | Lombristop | Mertec | Mertect | Mertect 160 | Mertect 340f | Mertect LSP | Metasol tk 10 | Metasol TK 100 | Metasol TK-100 | Mintesol | Mintezol | Mintezole | Minzolum | MK 360 | Mycozol | Nemacin | Nemapan | Omnizole | Ormogal | Pitrizet | Polival | RPH | Sanaizol 100 | Sistesan | Storite | Syntol M100 | TBDZ | TBZ | TBZ 6 | TBZ 60W | Tebuzate | Tecto | Tecto 10P | Tecto 40F | Tecto 60 | Tecto b | Tecto RPH | Testo | Thiaben | Thiabendazol | Thiabendazole(usan) | Thiabendazole | BAN | BSI | ISO | JMAF | USAN | Thiabendazolum | Thiabendole | Thiabenzazole | Thiabenzole | Thibendole | Thibenzol | Thibenzole | Thibenzole 200 | Thibenzole att | Thiprazole | Tiabenda | Tiabendazol | Tiabendazole | Tiabendazole | INN | Tiabendazolum | Tibimix 20 | TMG | Tobaz | Top form wormer | Tresaderm | Triasox | Tubazole
Thiaclopridi72
(Z)-[3-[(6-chloro-3-pyridinyl)methyl]-2-thiazolidinylidene]cyanamide | Thiacloprid | (Z)-3-(6-chloro-3-pyridylmethyl)-1,3-thiazolidin-2-ylidenecyanamide
Thiamethoxami81
3-(2-Chloro-1,3-thiazol-5-ylmethyl)-5-methyl-1,3,5-oxadiazinan-4-ylidene(nitro)amine | 3-[(2-Chloro-1,3-thiazol-5-yl)methyl]-5-methyl-N-nitro-1,3,5-oxadiazinan-4-imine | 3-[(2-Chloro-5-thiazolyl)methyl]tetrahydro-5-methyl-N-nitro-4H-1,3,5-oxadiazin-4-imine | Actara | Adage | Cruiser | Diacloden
Thiazopyri4
Mandate | Methyl 2-(difluoromethyl)-5-(4,5-dihydro-2-thiazolyl)-4-(2-methylpropyl)-6-(trifluoromethyl)-3-pyridinecarboxylate | MON 13200 | RH 123652 | Thiazophyr | Thiazopyr | ANSI | BSI | Visor
Thidiazuron+i42
(N-1,2,3-Thiadiazolyl-5)-N'-phenylurea | (phenylamino)-N-(1,2,3-thiadiazol-5-yl)carboxamide | N-phenyl-N'-1,2,3-thiadiazol-5-ylurea | Thidiazuron | 1-Phenyl-3-(1,2,3-thiadiazol-5-yl)urea
thifensulfuron-methyl51
Thiobencarb+i53
(S-(4-Chlorobenzyl)N,N-diethylthiolcarbamate) | Benthiocarb | Bolero | Carbamic acid | diethylthio- | S-(P-chlorobenzyl) ester | Caswell No. 207DA | Diptevur | P-chlorobenzyl diethylthiolcarbamate | S-((4-Chlorophenyl)methyl) diethylcarbamothioate | S-((4-Chlorophenyl)methyl)diethylcarbamothioate | S-(4-Chlorobenzyl) diethylthiocarbamate | S-(4-Chlorobenzyl) diethylthiolcarbamate | S-(4-chlorobenzyl)-N,N-diethylthiocarbamate | S-(p-chlorobenzyl) diethylthiocarbamate | S-4-Chlorobenzyl diethylthiocarbamate | Saturn | Saturn (herbicide) | Saturn (pesticide) | Saturno | Siacarb | Tamariz
thiochlorfenphim3
thiochlorphenphime
Thiodicarb+i54
(3EZ,12EZ)-3,7,9,13-tetramethyl-5,11-dioxa-2,8,14-trithia-4,7,9,12-tetraazapentadeca-3,12-diene-6,10-dione | Dimethyl N,N′-[thiobis[(methylimino)carbonyloxy]]bis[ethanimidothioate]
thiometon21
dithiométon, M-81
Thiophanate-methyl+i74
1,2-Di-(3-methoxycarbonyl-2-thioureido)benzene | Thiophanic acid-methyl
Thirami84
Arasan | Bis((dimethylamino)carbonothioyl) disulfide | Bis(dimethyl thiocarbamoyl)disulfide | Bis(dimethyl-thiocarbamoyl)-disulfid | Bis(dimethylthiocarbamoyl) disulfide | Disulfure de tetramethylthiourame | N,N'-(dithiodicarbonothioyl)bis(N-methylmethanamine) | N,N-Tetramethylthiuram disulfide | Nomersan | Pomarsol | Rezifilm | Tetramethyl-thiram disulfid | Tetramethylenethiuram disulfide | Tetramethylthioperoxydicarbonic diamide | Tetramethylthiuram disulfide | Tetramethylthiurane disulfide | Tetrathiuram disulfide | Thirame | Thiramum | Thiuram | TMTD | [Me2NC(S)S]2 | alpha,Alpha'-dithiobis(dimethylthio)formamide
titanium dioxidei624
tolclofos-methyl52
tolylfluanid42
Tralkoxydimi4
2-((1E)-2-ethoxy-1-ethyl-2-azavinyl)-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one | 2-(1-(Ethoxyimino)propyl)-3-hydroxy-5-(2,4,6-trimethylphenyl)-2-cyclohexen-1-one | 2-(1-Ethoxyimino-propyl)-3-hydroxy-5-(2,4,6-trimethyl-phenyl)-cyclohex-2-enone | 2-(N-ethoxypropanimidoyl)-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one | 2-(N-ethoxypropanimidoyl)-3-hydroxy-5-mesitylcyclohex-2-en-1-one | 2-[(1E)-N-ethoxypropanimidoyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-en-1-one | 2-[(1E)-N-Ethoxypropanimidoyl]-3-hydroxy-5-mesityl-2-cyclohexen-1-one | 2-[(1E)-N-Ethoxypropanimidoyl]-3-hydroxy-5-mesitylcyclohex-2-en-1-one | 2-[1-(ethoxyimino)propyl]-3-hydroxy-5-(2,4,6-trimethylphenyl)cyclohex-2-enone | 2-{1-[(E)-Ethoxyimino]-propyl}-3-hydroxy-5-(2,4,6-trimethyl-phenyl)-cyclohex-2-enone | Achieve | Grasp | Splendor | Tralkoxidym
transfluthrin41
Triadimefoni53
1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)-2-butanone | 1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one | Triadimefon | (RS)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-one
Triadimenoli5
1-(4-Chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | Triadimenol | (1RS,2RS;1RS,2SR)-1-(4-chlorophenoxy)-3,3-dimethyl-1-(1H-1,2,4-triazol-1-yl)butan-2-ol | •_-(4-chlorophenoxy)-a-(1,1-dimethylethyl)-1H-1,2,4-triazole-1-ethanol
Triallate+i64
2,3,3-Trichloro-2-propene-1-thiol diisopropylcarbamate | 2,3,3-Trichloroallyl diisopropylthiocarbamate | 2,3,3-Trichloroallyl N,N-diisopropylthiocarbamate | 2-Propene-1-thiol | 2,3,3-trichloro- | diisopropylcarbamate | Avadex be | Avadex BW | Caswell No. 870A | Diisopropylthiocarbamic acid S-(2,3,3-trichloroallyl) ester | DIIsopropyltrichloroallylthiocarbamate | Dipthal | N,N-Diisopropyl-2,3,3-trichlorallyl-thiolcarbamate | RCRA waste no. U389 | S-(2,3,3-Trichloro-2-propenyl) diisopropylthiocarbamate | S-(2,3,3-Trichloroallyl) diisopropylthiocarbamate | S-(2,3,3-Trichloroallyl) N,N-diisopropylthiocarbamate | S-(2,3,3-Trichloroallyl)diisopropylthiocarbamate | S-(2,3,3-trichloroprop-2-en-1-yl) diisopropylthiocarbamate | S-2,3,3-Trichloroallyl diisopropylthiocarbamate | S-2,3,3-Trichloroallyl N,N-diisopropylthiocarbamate | S-2,3,3-Trichloroallyl-N,N-diisopropylthiolcarbamate | Tri-allate | Triallic acid | Triamyl | Trichloroallyl dIIsopropylthiocarbamate
Triasulfuroni51
1-[2-(2-Chloroethoxy)phenylsulfonyl]-3-(4-methoxy-6-methyl-1,3,5-triazin-2-yl)urea | 2-(2-Chloroethoxy)-N-{[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)amino]carbonyl}benzenesulfonamide | Logran
Tribenuron-methyli52
Methyl 2-[({[(4-methoxy-6-methyl-1,3,5-triazin-2-yl)(methyl)amino]carbonyl}amino)sulfonyl]benzoate | METHYL 2-[4-methoxy-6-methyl-1,3,5-trazin-2-yl(methyl)carbamoylsulfamoyl]benzoate | Sulfmethmeton-methyl | Tribenuron methyl | Tribenuron methyl ester
TRIBUTYLTIN NAPHTHENATE3
Trichlorfon+i75
(+-)-Trichlorfon | 1-Hydroxy-2,2,2-trichloroethylphosphonic acid dimethyl ester | Chlorophos | Methyl chlorophos | Metrifonate | Metrifonato | Metrifonatum
Triclopyri4
3,5,6-trichloro-2-pyridyloxyacetic acid | [(3,5,6-trichloro-2-pyridinyl)oxy]acetic acid
Tridemorphi3
2,6-Dimethyl-4-tridecyl-Morpholine | 2,6-Dimethyl-4-tridecylmorpholine | 2,6-Dimethyl-N-tridecyl-Morpholine | 4-Tridecyl-2,6-dimethylmorpholine | BASF 220F | Calixin | Calixine | Dimethyl-2,6 tridecyl-4 morpholine | Elbamorph | F 220 (Fungicide) | Kalinin | Kalixin | N-Tridecyl-2,6-dimethylmorpholin | N-Tridecyl-2,6-dimethylmorpholine | Tridemorf | Tridemorphe
Trifloxystrobini63
methyl (E)-methoxyimino-{(E)-alpha--[1-(alpha-,alpha-,alpha--trifluoro-m-tolyl)ethylideneaminooxy]-o-tolyl}acetate | methyl (alpha-E)-alpha--(methoxyimino)-2-[[[[(1E)-1-[3-(trifluoromethyl)phenyl]ethylidene]amino]oxy]methyl]benzeneacetate
Triflumizole5
triflumuron4
Trifluralini74
2,6-Dinitro-N,N-dipropyl-4-(trifluoromethyl)aniline | 2,6-dinitro-N,N-dipropyl-4-(trifluoromethyl)benzenamine | 2,6-Dinitro-N,N-dipropyl-4-trifluoromethylaniline | alpha-,alpha-,alpha--trifluoro-2,6-dinitro-N,N-dipropyl-p-toluidine
triforine51
trinexapac-ethyl4
Triticonazole+i63
trunc-call3
uniconazole-P5
Ureai268
Vernolate+i43
Carbamic acid | dipropylthio-,S-propyl ester | Caswell No. 711 | Dipropylcarbamothioic acid S-propyl ester | Dipropylthiocarbamic acid S-propyl ester | N-propyl-di-n-propylthiolcarbamate | N-propyldi-n-propylthiocarbamate | Perbulate | Propyl dipropylthiolcarbamate | Propyl-n,n-dipropylthiolcarbamate | Propyl-n-di-n-propylthiolcarbamate | S-propyl dipropylcarbamothioate | S-propyl dipropylthiocarbamate | S-propyl-n,n-dipropylthiocarbamate | Vanalate | Vernam 7E | Vernam e vernam g surpass e | Vernam g | Vernolat | Vernolic acid
Warfarin+i67
(phenyl-1 acetyl-2 ethyl) 3-hydroxy-4 coumarin | (phenyl-1 acetyl-2 ethyl) 3-hydroxy-4 coumarine | (S)-4-hydroxy-3-(3-oxo-1-phenylbutyl)-2-benzopyrone | 1-(4'-Hydroxy-3'-coumarinyl)-1-phenyl-3-butanone | 200 Coumarin | 3-(1'-Phenyl-2'-acetylethyl)-4-hydroxycoumarin | 3-(Acetonylbenzyl)-4-hydroxycoumarin | 3-(alpha-Acetonylbenzyl)-4-hydroxycoumarin | 3-(alpha-Phenyl-beta-acetylaethyl)-4-hydroxycumarin | 3-(alpha-Phenyl-beta-acetylethyl)-4-hydroxycoumarin | 4-Hydroxy-3- (3-oxo-1-fenyl-butyl) cumarine | 4-Hydroxy-3- (3-oxo-1-phenyl-butyl)-cumarin | 4-Hydroxy-3-(3-oxo-1-fenyl-butyl) cumarine | 4-Hydroxy-3-(3-oxo-1-phenyl-butyl)-cumarin | 4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-1-benzopyran-2-one | 4-Hydroxy-3-(3-oxo-1-phenylbutyl)-2H-chromen-2-one | 4-Hydroxy-3-(3-oxo-1-phenylbutyl)coumarin | 4-Idrossi-3- (3-oxo-)-fenil-butil)-cumarine | 4-Idrossi-3-(3-oxo-)-fenil-butil)-cumarine | 4-Idrossi-3-(3-oxo-1-fenil-butil)-cumarine | 4oh-coumarin deriv. | Arab rat death | Arab rat deth | Athrombin-k | Athrombine-k | Brumolin | Co-rax | Compound 42 | Coumadin | Coumafen | Coumafene | Coumaphen | Coumaphene | Coumarins | Coumefene | Cov-R-tox | D-Con | delta-Con | Dethmor | Dethnel | Dicusat e | DL-3-(alpha-acetonylbenzyl)-4-hydroxycoumarin | Eastern states duocide | Fasco fascrat powder | Frass-ratron | Jantoven | Killgerm sewarin p | Kumader | Kumadu | Kumatox | Kypfarin | Latka 42 | Lawarin | Liqua-tox | Maag rattentod cum | Mar-frin | Marevan | Martin'S mar-frin | Maveran | Mouse pak | Place-pax | Prothromadin | Rat & mice bait | Rat and mice bait | Rat-a-way | Rat-alpha-way | Rat-b-gon | Rat-beta-gon | Rat-gard | Rat-kill | Rat-mix | Rat-O-cide #2 | Rat-O-cide no. 2 | Rat-ola | Rat-trol | Ratorex | Ratox | Ratoxin | Ratron | Ratron g | Rats-no-more | Ratten-koederrohr | Rattenstreupulver neu schacht | Rattenstreupulver new schacht | Rattentraenke | Rattunal | RAX | RCR grey squirrel killer concentrate | Ro-deth | Rodafarin | Rodafarin c | Rodex | Rodex blox | Rosex | Rough & ready mouse mix | Rough and ready mouse mix | Sakarat | Sewarin | Solfarin | Sorexa plus | Spray-trol brand roden-trol | Temus w | Tox-hid | Twin light rat away | Vampirinip II | Vampirinip III | Waran | Warfant | Warfarin sodium | Zoocoumarin
XRD-5633
Zinc dimethyldithiocarbamate+i86
(SP-4-1)-bis(dimethylcarbamodithioato-S,S')-zinc | (T-4)-bis (dimethyldithiocarbamate-S,S )zinc | (T-4)-bis(dimethylcarbamodithioato-S ,S')-zinc | (T-4)-bis(dimethylcarbamodithioato-S,S')-zinc | (T-4)-Bis(dimethyldithiocarbamato-S,S')zinc | (T-4)-Bis(dimethyldithiocarbamato-S,S')zinc (9CI) | Aaprotect | Aaprotent | Aavolex | Aazira | Accelerator l | Accelerator MZ powder | Aceto zded | Aceto ZDMD | Alcobam ZM | Amyl zimate | Ancazate me | Antene | Bis(dimethylcarbamodithiato-s,s')-zinc | Bis(dimethylcarbamodithioato-s,s')zinc | Bis(dimethyldithiocarbama to)zinc | Bis(dimethyldithiocarbamat)zinc | Bis(dimethyldithiocarbamato)zinc | Bis(n,n-dimetil-ditiocarbammato)di zinco | Bis-dimethyldithiocarbamate de zinc | Carbamic acid | dimethyldithio- | Z inc salt (2:1) | Carbamic acid | dimethyldithio- | zinc salt (2:1) | Carbamodithioic acid | dimethyl- | zinc salt | Carbazinc | Caswell No. 931 | Ciram | Corona corozate | Corozate | Crittam | Crittan | Crorzate | Cuman | Cuman l | Cymate | Dimethylcarbamodithioic acid | zinc complex | Dimethylcarbamodithioic acid | zinc salt | Dimethyldithiocarbamate zinc salt | Dimethyldithiocarbamic acid zinc salt | Dimethyldithiocarbamic acid | zinc salt | Drupina 90 | Eptac 1 | Fuclasin | Fuclasin ultra | Fuclasin-ultra | Fuklasin | Fungostop | Hermat ZDM | Hexazir | Karbam white | Methasan | Methazate | Methyl cymate | Methyl zimate | Methyl zineb | Methyl ziram | Mexene | Mezene | Micosin F30 | Milam | Milbam | Milban | Molurame | MYCR onil | Mycronil | Nocceler PZ | Octocure ZDM-50 | Orchard brand ziram | Perkacit ZDMC | Pomarsol z forte | Pomarsol z-forte | Pomarsolz | Pomarzol z-forte | Prodaram | Ramedit | RCRA waste no. P205 | Rhodiacid | Rodisan | Sabceler PZ | Soxinal PZ | Soxinol PZ | Thiuram e | Tricarbamix z | Trikagol | Triscabol | Tsimat | Tsiram | Tsiram(russian) | Ultra zinc DMC | USAF p-2 | Vancide | Vancide MA-96 | Vancide mz-96 | Vulcacure | Vulcacure ZM | Vulkacit l | Vulkacite l | Weisstaub | Z-c spray | Z-c-spray | Zarlate | Zarlate;carbamodithioic acid | ZC | Zeralte | Zerlate | Zimate | Zimate | methyl | Zinc bis dimethyldithiocarbamate | Zinc bis(dimethyldithiocarbamate) | Zinc bis(dimethyldithiocarbamoyl) disulfide | Zinc bis(dimethyldithiocarbamoyl)disulfide | Zinc bis(dimethyldithiocarbamoyl)disulphide | Zinc bis(dimethylthiocarbamoyl) disulfide | Zinc bis(dimethylthiocarbamoyl)disulfide | Zinc dimethyl dithiocarbamate | Zinc dimethyldithiocarbamic acid | Zinc n,n-dimethyldithiocarbamate | Zincmate | Zink dimethyldithiocarbamate | Zink-bis(n,n-dimethyl-dithiocarbamaat) | Zink-bis(n,n-dimethyl-dithiocarbamat) | Zinkcarbamate | Ziradin | Ziram | Ziram F4 | Ziram granuflo | Ziram technical | Ziram W7 6 | Ziram W76 | Zirame | Ziramvis | Zirasan | Zirasan 90 | Zirberk | Zirberk thynylestradiol ram | Ziretec | Zirex 90 | Zirex fungicide | Ziride | Zirthane | Zitox
Zinc phosphide+i84
Trizinc diphosphate | Zn3P2
Zinc pyrithione+i72
(T-4)-Bis(1-hydroxy-2(1H)-pyridinethionato-O,S)zinc | 2(1H)-Pyridinethione | 1-hydroxy- | zinc complex | 2-Mercaptopyridine 1-oxide zinc salt | 2-Mercaptopyridine-1-oxide | zinc salt | 2-Pyridinethiol-1-oxide | zinc salt | Biocut ZP | Bis(1-hydroxy-2(1H)-pyridinethionato)zinc | Bis(1-hydroxy-2-(1H)-pyridinethionato)zinc | Bis(2-pyridinethiol-1-oxide)zinc | Bis(2-pyridylthio)zinc 1,1'-dioxide | Breck one dandruff shampoo | Danex | Evafine P 50 | Finecide ZPT | Head and shoulders | Hokucide ZPT | Niccanon SKT | Omadine zinc | Pyrithion-zink | Pyrithione zinc | Sebulon shampoo | Tomicide Z 50 | Top brass | Vancide p | Vancide ZP | Wella crisan | Zinc - pyrion | Zinc 1-hydroxy-2-pyridinethione | Zinc 1-hydroxypyridine-2-thione | Zinc 2-mercaptopyridine N-oxide | Zinc 2-pyridinethiol 1-oxide | Zinc 2-pyridinethiol-1-oxide | Zinc bis(2-pyridylthio)-N-oxide | Zinc omadine | Zinc PT | Zinc pyrethion | Zinc pyridine-2-thiol 1-oxide | Zinc pyridine-2-thiol-1-oxide | Zinc pyridinethione | Zincon dandruff shampoo | ZNPT | ZPT
Zineb+i65
((1,2-Ethanediylbis(carbamodithioato))(2-))zinc | 1,2-Ethanediylbis(carbamodithioato) (2-)-S,S'-zinc | 1,2-Ethanediylbiscarbamodithioic acid | zinc complex | Aaphytora | Aphytora | Aspor | Asporum | Blightox | Blizene | Bombardier | Carbadine | Chem zineb | Cineb | Clortocaffaro | Crittox | Crystal zineb | Cynkotox | Daisen | Deikusol | Devizeb | Dipher | Discon | Discon-z | Dithane 65 | Dithane z | Dithane Z-78 | Ditiamina | Ethylenebis(dithiocarbamato)zinc | Ethylenebis(dithiocarbamic acid) | zinc salt | Fitodith 80 | Fungo-pulvit | Funjeb | Hexathane | Kupratsin | Kypzin | Lipotan | Lirotan | Lonacol | Metiram-zinc | Micide | Micide 55 | Novosir n | Novozin N 50 | Novozir | Novozir n | Novozir N 50 | Pamosol 2 forte | Parzate | Parzate c | Parzate zineb | Perosin | Perosin 75B | Perozin | Perozine | Perozine 75B | Phytox | Pilzol SZ | Polyram z | Sperlox-z | Taloberg | Tanazon | Thiodow | Thionic m | Tiazin | Tiezene | Tritoftorol | Tsineb | Unizeb | Zebenide | Zebtox | Zidan | zinc ethane-1,2-diylbis(dithiocarbamate) | Zinc ethane-1,2-diyldicarbamodithioate | Zinc ethylene bisdithiocarbamate | Zinc ethylene-1,2-bisdithiocarbamate | Zinc ethylenebis(dithiocarbamate) (polymeric) | Zinc ethylenebisdithiocarbamate | Zinc ethylenebisthiocarbamate | Zinc n,n'-ethylenebisdithiocarbamate | Zincethylenebisdithiocarbamate | Zineb 75 | Zineb 75 WP | Zineb 80 | Zineb-R | Zinosan | Zipar | [ethane-1,2-diylbiscarbamodithioato(2-)-kappaS]zinc
α-pinene6
α-pinene, 2,6,6-trimethylbicyclo[3.1.1]hept-2-ene; cyclic dexadiene


Your Feedback makes Toxno better for everyone